blob_id stringlengths 40 40 | directory_id stringlengths 40 40 | path stringlengths 3 616 | content_id stringlengths 40 40 | detected_licenses listlengths 0 112 | license_type stringclasses 2
values | repo_name stringlengths 5 115 | snapshot_id stringlengths 40 40 | revision_id stringlengths 40 40 | branch_name stringclasses 777
values | visit_date timestamp[us]date 2015-08-06 10:31:46 2023-09-06 10:44:38 | revision_date timestamp[us]date 1970-01-01 02:38:32 2037-05-03 13:00:00 | committer_date timestamp[us]date 1970-01-01 02:38:32 2023-09-06 01:08:06 | github_id int64 4.92k 681M ⌀ | star_events_count int64 0 209k | fork_events_count int64 0 110k | gha_license_id stringclasses 22
values | gha_event_created_at timestamp[us]date 2012-06-04 01:52:49 2023-09-14 21:59:50 ⌀ | gha_created_at timestamp[us]date 2008-05-22 07:58:19 2023-08-21 12:35:19 ⌀ | gha_language stringclasses 149
values | src_encoding stringclasses 26
values | language stringclasses 1
value | is_vendor bool 2
classes | is_generated bool 2
classes | length_bytes int64 3 10.2M | extension stringclasses 188
values | content stringlengths 3 10.2M | authors listlengths 1 1 | author_id stringlengths 1 132 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
62363c4bcc24d91b45188cf7f657fda66070fe0d | 37146b1529bfb8094d5ef17734498aba1e701b33 | /python/python_course/pythonStudy4/FangWenKongZhiExample.py | 82883cdaa0bcd2c25e723093041cf2edf8fa576c | [] | no_license | nanfeng729/code-for-test | 9c8e3736ac4c86a43002a658faf37349817de130 | 28071453c38742bffd5b5bdf7461bffdaa6c96be | refs/heads/master | 2022-10-07T17:59:44.558278 | 2020-06-06T10:19:19 | 2020-06-06T10:19:19 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 289 | py | class fwkz:
a = 0
b = 0
_c = 0 # 定义受保护的属性
__d = 0 # 定义私有的属性
def jisuan(self):
return self.a + self.b
def jisuan2(self):
return self.a + self._c
def jisuan3(self):
return self.b + self.__d | [
"liuyifeiflying1991@outlook.com"
] | liuyifeiflying1991@outlook.com |
c1bc4002b45701e9ddcbdae5fbd9f337effbe930 | 587dbdf730b6cc3e693efc5dca5d83d1dd35ee1a | /leetcode/1501-1800/1785.py | d13fff05ea446efdd48f2dcbc0f23ee12d81b53b | [] | no_license | Rivarrl/leetcode_python | 8db2a15646d68e4d84ab263d8c3b6e38d8e3ea99 | dbe8eb449e5b112a71bc1cd4eabfd138304de4a3 | refs/heads/master | 2021-06-17T15:21:28.321280 | 2021-03-11T07:28:19 | 2021-03-11T07:28:19 | 179,452,345 | 3 | 1 | null | null | null | null | UTF-8 | Python | false | false | 680 | py | # -*- coding: utf-8 -*-
# ======================================
# @File : 1785
# @Time : 2021/3/8 12:20
# @Author : Rivarrl
# ======================================
from algorithm_utils import *
class Solution:
"""
[1785. 构成特定和需要添加的最少元素](https://leetcode-cn.com/problems/minimum-elements-to-add-to-form-... | [
"1049793871@qq.com"
] | 1049793871@qq.com |
6f4f236a04b08ff986588d8d74bf27e19b3776ce | a9958f7c7887a92ec9fc48b02ed8a5cb75a03311 | /db.py | 1b274e58f4478c7f209d2e9b19cf25ce7d613166 | [] | no_license | ahmedfadhil/Dynamically-Weighted-Bandwidth- | 816c18777b49f3520433e65accf9e179f64e0836 | 1c8821aec73f32e704d12cebffcda01d1319bc80 | refs/heads/master | 2021-01-02T09:39:58.814463 | 2017-08-03T21:55:26 | 2017-08-03T21:55:26 | 99,271,051 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 4,374 | py | import matplotlib.pyplot as plt
from matplotlib import style
import numpy as np
from sklearn.datasets.samples_generator import make_blobs
style.use('ggplot')
X, y = make_blobs(n_samples=15, centers=3, n_features=2)
##X = np.array([[1, 2],
## [1.5, 1.8],
## [5, 8],
## [8, 8],
## ... | [
"ahmed.fadhil@alumni.emu.edu.tr"
] | ahmed.fadhil@alumni.emu.edu.tr |
bca17f6f16c5c7b53f36b1772c1609844002a2d0 | 45a61af9028a1805c08b6f7638c7aebe8140bd2d | /Groundwater/mf6/autotest/test_z01_nightly_build_examples.py | 271101a6d317d1429ed62e0954a5f125c5a0fd18 | [] | no_license | gumilar19/Personal | 1c1fac036af3a4b9d4d425b7c8cb604271b94fd2 | c666b07c5184006aca8e6ad946cc98ef72dfe9fe | refs/heads/master | 2023-08-14T20:39:07.164849 | 2021-09-29T11:19:10 | 2021-09-29T11:19:10 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 7,397 | py | import os
import sys
import subprocess
import pathlib
try:
import pymake
except:
msg = 'Error. Pymake package is not available.\n'
msg += 'Try installing using the following command:\n'
msg += ' pip install https://github.com/modflowpy/pymake/zipball/master'
raise Exception(msg)
try:
import fl... | [
"52244870+ccalvocm@users.noreply.github.com"
] | 52244870+ccalvocm@users.noreply.github.com |
2c84b88b2248d07bc3fdaaa1c84bb232af9210d9 | 6558766df338730772d02a318e65bfa46cff40b6 | /apps/openprofession/migrations/0037_simulizatordata.py | 856c0742ca3f953cf907bf71e7a9709af76ae251 | [] | no_license | ITOO-UrFU/openedu | 02dc265872e2de1d74b1e8eca0c6596c7860841a | 7c6507d671653fc0ccf35b5305f960eb32e7159f | refs/heads/master | 2021-01-20T21:16:39.987744 | 2019-08-07T10:02:12 | 2019-08-07T10:02:12 | 101,761,728 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,403 | py | # -*- coding: utf-8 -*-
# Generated by Django 1.11.4 on 2018-03-13 14:13
from __future__ import unicode_literals
from django.db import migrations, models
class Migration(migrations.Migration):
dependencies = [
('openprofession', '0036_pdavailable'),
]
operations = [
migrations.CreateMod... | [
"mastergowen@gmail.com"
] | mastergowen@gmail.com |
bfff0b51dad9c1f7c57317b42ae7678d470157f9 | 5a977855c32226303bdec2585dc7d159a801b12f | /material/codigo/pygame-camera/macroscope/macroscope.py | d3adce138aba14217294e7b8d57667288bf88297 | [] | no_license | javacasm/RaspberryAvanzado | 5eecd62c3598b2e36bc4ee91c3e96b33734903bf | bbccc7b8af8c2c9b5e2e298b3e5c063d9aa056c1 | refs/heads/master | 2021-09-11T16:45:18.263481 | 2018-04-09T22:06:11 | 2018-04-09T22:06:11 | 108,258,204 | 4 | 0 | null | null | null | null | UTF-8 | Python | false | false | 8,612 | py | #!/usr/bin/env python
# RPi Macroscope by 648.ken@gmail.com, December 2017
# https://www.raspberrypi.org/learning/push-button-stop-motion/worksheet/
# https://raspberrypi.stackexchange.com/questions/28302/python-script-with-loop-that-detects-keyboard-input
import os, sys, time
from picamera import PiCamera
from time ... | [
"javacasm@gmail.com"
] | javacasm@gmail.com |
6230c89fbf90c5fe08760c737ce41aeee110b049 | fde10302616f4bbba5a67a33decb65e47765e268 | /misc/v1/reconstruction/meshroom_to_log.py | 798f63beb6c87bdb1d5544ec8dea13d120d761ec | [] | no_license | laurelkeys/ff | b1f562f2e3caf2cd0616ca93fff4fb3872e55cdc | bac774e1f7b3131f559ee3ff1662836c424ebaa5 | refs/heads/master | 2023-02-23T17:46:49.011034 | 2022-01-21T20:31:59 | 2022-01-21T20:31:59 | 214,757,656 | 1 | 1 | null | 2023-02-11T00:30:56 | 2019-10-13T03:58:59 | Python | UTF-8 | Python | false | false | 4,269 | py | import os
import glob
import json
import argparse
import collections
import numpy as np
# ref.:
# [1] https://www.tanksandtemples.org/tutorial/
# [2] https://colmap.github.io/format.html#images-txt
# [3] https://github.com/colmap/colmap/blob/dev/src/estimators/pose.h#L125
# [4] https://github.com/alicevision/mesh... | [
"tiagoloureirochaves@gmail.com"
] | tiagoloureirochaves@gmail.com |
4a93f895c4f634e938a00892439e5aa761ecf1b5 | 3d61fe0f49f5d344fc32a6faa799f0a46deec9a5 | /2017/AoC-2017-13v2.py | 290341cd10f0980f65f036c7d6c15a02ddab3382 | [] | no_license | sbeaumont/AoC | 558296fd26cd5272e33d3cb9113c09e4945c98ac | 406eda614d8434d8feb71fe1262f1fda54972a12 | refs/heads/master | 2022-12-13T07:38:36.089775 | 2022-12-04T21:11:49 | 2022-12-04T21:11:49 | 75,467,985 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 578 | py | PUZZLE_INPUT_FILE_NAME = "AoC-2017-13-input.txt"
# Parse parent and children names
with open(PUZZLE_INPUT_FILE_NAME) as puzzle_input_file:
firewall = {int(line.split(":")[0]): int(line.split(":")[1]) for line in puzzle_input_file.readlines()}
max_depth = max(firewall, key=firewall.get)
def check_layers(wait_tim... | [
"sbeaumont@xebia.com"
] | sbeaumont@xebia.com |
2670d4a865a34c6b12557710f3b157b604b6bf68 | 148cb99e0f23679c20243470ad62dc4155aa5252 | /baseinfo/migrations/0016_auto_20191206_0806.py | 8d98453f8d32b5509559f2cb37242495b58c3609 | [] | no_license | Hamidnet220/tax | 46060f24b55a4f348194599d59247ff9435f4379 | 000051be5df6a98f679d13a94e37b9ee30efd5a9 | refs/heads/master | 2020-06-19T09:41:20.998214 | 2019-12-10T01:01:17 | 2019-12-10T01:01:17 | 196,666,093 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 608 | py | # Generated by Django 2.1.7 on 2019-12-06 08:06
from django.db import migrations, models
class Migration(migrations.Migration):
dependencies = [
('baseinfo', '0015_guarantee_guarantee_file'),
]
operations = [
migrations.AlterField(
model_name='guarantee',
name='g... | [
"kiani.hamidreza@gmail.com"
] | kiani.hamidreza@gmail.com |
b90a0305484644a6728e50d68732ee9e6989bb14 | 478fad340a97fc14d365b95bbd6f8ac1dcc71953 | /121/Solution.py | d76a39e78ef9cadd8e4004cc32002f4a3d0d5986 | [] | no_license | sandyg05/leetcode | 93cca3b3ce4f38cf1ea1c6d3e8400d7b6b776c37 | e9d8036e2be6dbd1b8c958431e07dc35b88ebfa8 | refs/heads/master | 2022-07-16T10:03:59.529470 | 2020-05-13T05:35:49 | 2020-05-13T05:35:49 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 994 | py | """
Say you have an array for which the ith element is the price of a given stock on day i.
If you were only permitted to complete at most one transaction (i.e., buy one and sell one share of the stock), design an algorithm to find the maximum profit.
Note that you cannot sell a stock before you buy one.
Example 1:
... | [
"zrc720@gmail.com"
] | zrc720@gmail.com |
2bc1fcc7b2f69fdf2a3224d4812bd611106212fd | ca3a49676cdf1016b2d729f0432b451d35b7a281 | /bad-solutions/add.py | 698f358d6ce95ac0d0d3832d8c44a19f39928fd9 | [
"MIT"
] | permissive | SquareandCompass/code-align-evals-data | 3bb71b605316f56bb27466f23706a329f3fb4938 | 97446d992c3785d6605f1500b2c9b95d042e7b9c | refs/heads/main | 2023-06-19T12:47:56.277363 | 2021-07-21T00:22:56 | 2021-07-21T00:22:56 | 640,147,842 | 0 | 1 | null | 2023-05-13T06:22:30 | 2023-05-13T06:22:29 | null | UTF-8 | Python | false | false | 575 | py | def add(lst):
"""Given a non-empty list of integers lst. add the even elements that are at odd indices..
Examples:
add([4, 2, 6, 7]) ==> 2
"""
return sum([lst[i] for i in range(1, len(lst) / 2, 2) if lst[i] % 2 == 0])
def check(candidate):
# Check some simple cases
assert candidate... | [
"barnes@openai.com"
] | barnes@openai.com |
a5075c05b906fd9b22238fdec92901e48a23a4c7 | ca7aa979e7059467e158830b76673f5b77a0f5a3 | /Python_codes/p02817/s121273903.py | c74297c5df6c42af00d7dd1b1408fea1fb86e8a6 | [] | no_license | Aasthaengg/IBMdataset | 7abb6cbcc4fb03ef5ca68ac64ba460c4a64f8901 | f33f1c5c3b16d0ea8d1f5a7d479ad288bb3f48d8 | refs/heads/main | 2023-04-22T10:22:44.763102 | 2021-05-13T17:27:22 | 2021-05-13T17:27:22 | 367,112,348 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 41 | py | x=list(input().split())
print(x[1]+x[0])
| [
"66529651+Aastha2104@users.noreply.github.com"
] | 66529651+Aastha2104@users.noreply.github.com |
0e9a38665795bd642e825d58f2ad24a34ebb9439 | f8c3c677ba536fbf5a37ac4343c1f3f3acd4d9b6 | /ICA_SDK/test/test_instrument.py | aeb50805e0f9f55fb14b9f8cfa35dbca74de8c92 | [] | no_license | jsialar/integrated_IAP_SDK | 5e6999b0a9beabe4dfc4f2b6c8b0f45b1b2f33eb | c9ff7685ef0a27dc4af512adcff914f55ead0edd | refs/heads/main | 2023-08-25T04:16:27.219027 | 2021-10-26T16:06:09 | 2021-10-26T16:06:09 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,573 | py | # coding: utf-8
"""
IAP Services
No description provided (generated by Openapi Generator https://github.com/openapitools/openapi-generator) # noqa: E501
The version of the OpenAPI document: v1
Generated by: https://openapi-generator.tech
"""
from __future__ import absolute_import
import unittest
... | [
"siajunren@gmail.com"
] | siajunren@gmail.com |
82e143ab368a2df624d5ba0dd94ba697a8484a59 | 59e87634c67508bf7eba8c8b9845354aefa57bc7 | /DL/yolo/YOLOV1/py_cpu_nms.py | 2ddfa1b49d7699c559417a89c11064070d65ca39 | [] | no_license | Caohengrui/MLAndDL | 48729b94b2232e628b699cf8d0d4a6c6e81a36f5 | d0637f58f45e9c091cd90bbfe9c207223d0994f3 | refs/heads/master | 2023-03-16T01:06:03.316463 | 2020-04-14T07:44:15 | 2020-04-14T07:44:15 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,060 | py | # --------------------------------------------------------
# Fast R-CNN
# Copyright (c) 2015 Microsoft
# Licensed under The MIT License [see LICENSE for details]
# Written by Ross Girshick
# --------------------------------------------------------
import numpy as np
def py_cpu_nms(dets,scores, thresh):
"""Pure Py... | [
"gzcl_wcon@126.com"
] | gzcl_wcon@126.com |
62de88d56a77477d8991a96a5087929d2d3d2770 | 55d6de252e61c4b60688ebd8b1f637807acc1e7c | /usl_recived_forigin_purchased/models/inharitstockpicking.py | 0eebab826a9be7c89947980bd5f2d26cbf056f25 | [] | no_license | mosadiqit/eerna_erp_uslbd | b707a1d49a4fce7c1543b63e0120e8f9b77b26ce | 73e3994a9e32df7809d244eb6592513162ab7853 | refs/heads/main | 2023-06-30T14:53:04.837197 | 2021-08-04T11:30:46 | 2021-08-04T11:30:46 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 9,242 | py | from odoo import models, fields, api, _
from odoo.exceptions import UserError, ValidationError
from odoo.osv.osv import osv
from odoo.tools.float_utils import float_compare, float_is_zero, float_round
class StockPickingInharit(models.Model):
_inherit = 'stock.picking'
@api.onchange('commercial_invoice')
... | [
"ibrahimalazhar264@gmail.com"
] | ibrahimalazhar264@gmail.com |
95ea3a56c120bb0d2c831b76684d982b54b6c5aa | 68bad4b3d92872bb5b77b4ee503e588d20511a27 | /python/core/test_scripts_MPI/my_population_collect_spikes_mpi.py | ff1caea364466e952b5219ea999cbb2671552f87 | [] | no_license | mickelindahl/bgmodel | 647be626a7311a8f08f3dfc897c6dd4466fc0a92 | 78e6f2b73bbcbecd0dba25caf99f835313c914ee | refs/heads/master | 2023-08-29T13:57:04.122115 | 2022-02-11T14:28:23 | 2022-02-11T14:28:23 | 17,148,386 | 7 | 3 | null | null | null | null | UTF-8 | Python | false | false | 677 | py | '''
Created on Sep 22, 2014
@author: mikael
'''
import numpy
import pickle
import sys
from toolbox.data_to_disk import mkdir
from toolbox.my_nest import collect_spikes_mpi
from toolbox.parallelization import comm
print sys.argv
fileName, =sys.argv[1:]
fileName+='data'
s,e=numpy.ones(2)*comm.rank(),numpy.ones(2)*comm... | [
"mickelindahl@gmail.com"
] | mickelindahl@gmail.com |
c64bb122fa1b142b05e8315ac85b8ea4cec85786 | 53fab060fa262e5d5026e0807d93c75fb81e67b9 | /gaussiana/ch3_2019_03_08_14_00_41_432668.py | 4bdc1e00e92765b8d5b29e95dceff6a7256f3781 | [] | no_license | gabriellaec/desoft-analise-exercicios | b77c6999424c5ce7e44086a12589a0ad43d6adca | 01940ab0897aa6005764fc220b900e4d6161d36b | refs/heads/main | 2023-01-31T17:19:42.050628 | 2020-12-16T05:21:31 | 2020-12-16T05:21:31 | 306,735,108 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 292 | py | import math
def calcula_gaussiana(x, mi, sigma):
if (sigma == 1 and x == 0 and mi == 0):
return 0
if (sigma == 0 or sigma == - math.sqrt(2*math.pi) or sigma == 1/math.sqrt(2*math.pi)):
return 0
return (1/sigma*math.sqrt(2*math.pi))**(-0.5((x - mi)/sigma)**2) | [
"you@example.com"
] | you@example.com |
278be94dc86a4923595fc1db156514e63a55f1c3 | 9abc2f4fbf1b31b5a56507437b4a8d9c3f3db7e6 | /deals/migrations/0001_initial.py | 4a8460e46f0e4b39cc2b66694382c60ac4a670ac | [] | no_license | odbalogun/ticketr | e9fe8461d66dabe395f0e1af8fbecc67dbb16e97 | 94f24c82f407f861f1614a151feb3fdd62b283e5 | refs/heads/master | 2022-11-30T22:40:30.931160 | 2019-08-09T14:34:38 | 2019-08-09T14:34:38 | 188,833,600 | 0 | 0 | null | 2022-11-22T03:50:30 | 2019-05-27T11:50:07 | Python | UTF-8 | Python | false | false | 3,263 | py | # Generated by Django 2.2.1 on 2019-05-06 23:17
import deals.models
from django.conf import settings
from django.db import migrations, models
import django.db.models.deletion
class Migration(migrations.Migration):
initial = True
dependencies = [
migrations.swappable_dependency(settings.AUTH_USER_MO... | [
"oduntan@live.com"
] | oduntan@live.com |
34c06dc74f45348f0075ae426c9ad58a2c008486 | 9bdc2e9f0382bd96ef3af4f9eca94fa58c5a4dc1 | /keras/mnist-privacy/model/pipeline_train.py | 0687d543d7075f6d1210e6bc5a96b7c003608086 | [
"Apache-2.0"
] | permissive | shicongisme/models | 90cf9a84b47c8d2a4de51fdfb7f6c4b9f796e317 | d8df07877aa8b10ce9b84983bb440af75e84dca7 | refs/heads/master | 2022-02-01T12:01:11.443827 | 2019-05-26T22:25:04 | 2019-05-26T22:25:04 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 8,112 | py | # Copyright 2018, The TensorFlow Authors.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed t... | [
"chris@fregly.com"
] | chris@fregly.com |
9eeb1275039275399a55eee9a0ae55d20a3de792 | 61a02aba5dde7c29ec65a87eb8a20af12d6c2b47 | /python basic/3118_최단경로2.py | ccce1ec174e94a7de53db843f1c74aeaad387cdd | [] | no_license | hksoftcorn/OfficialDocs | 0b4d0e2a71707e06ba7516e34ad176ee02726587 | cfd87d26efad484657f9493dead350cf0611a3e8 | refs/heads/master | 2023-06-30T07:09:33.641869 | 2021-07-31T14:35:28 | 2021-07-31T14:35:28 | 374,389,403 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 573 | py | V, E = map(int, input().split())
G = [[] for _ in range(V + 1)]
for _ in range(E):
u, v, w = map(int, input().split())
G[u].append((v, w))
visited = [False] * (V + 1)
dist = [0xfffffff] * (V + 1)
dist[1] = 0
p = [0] * (V + 1)
for _ in range(V):
u, min_key = 1, 0xfffffff
for i in range(1, V+1):
... | [
"hksoftcorn.dev@gmail.com"
] | hksoftcorn.dev@gmail.com |
6f4373a988fbcd023ca39c1755c9d361c3e7daff | 2fd14347b7f43864d8153bd1c6d79198302d21ea | /ex.002 root finding/nr_problem_case.py | 3d33bede021e71d689a6e8c5cd4a3b1edf781a2e | [] | no_license | family9od/ECAre | 0fe27ff290eaa702c754fedef8953260a67592fc | ea875ea14be9d99a5e4f2191382e6eedc702b557 | refs/heads/master | 2020-06-17T02:33:30.651909 | 2016-11-15T07:45:31 | 2016-11-15T07:45:31 | 75,047,845 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 791 | py | # -*- coding: utf8 -*-
# 2010112033 이상형 9/20
"""
1변수 방정식의 근을 찾느 방법 중 Newton-Raphson method 를 사용하여
어떤 함수 g(x) 의 근을 찾고자 함
아래 예는 newton_raphson method 를 사용하기 곤란한 경우임
"""
# 1 변수 방정식의 근을 찾는 함수를 모아둔 rootfinding 모듈을 불러들임
import rootfinding as rf
def g(x):
# 근을 구하고자 하는 함수
return x ** 3 - 2 * x + 2
def dgdx(x):
... | [
"CAD Client"
] | CAD Client |
9ae009652986c6b459f9d867a41a6f768070ebda | e28ce5cca66c56ee7446a46e18375430d0d404eb | /toys/12_go/gopy/go/location.py | 3b4f56c0d82834ba26f9afa924ca8d0bbcdfb3a8 | [
"MIT"
] | permissive | git4robot/PyKids | 4fb60c5b107527336d9e686a98988ba7a8354f31 | 866e45e13171322ad1892d604508cfee9f8086c8 | refs/heads/master | 2020-04-17T20:45:26.741363 | 2020-04-14T02:21:55 | 2020-04-14T02:21:55 | 166,919,523 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 665 | py | from go.utils import bold
class LocationError(Exception):
pass
class Location(object):
TYPES = {
'black': bold('*'),
'white': bold('o'),
'empty': '.',
}
def __init__(self, type):
if type not in self.TYPES:
raise LocationError('Type must be one of the foll... | [
"49167781@qq.com"
] | 49167781@qq.com |
ac07a53e15aef0bb493402d8d4c3712a747239bb | 3a6cbe6940b657ac6b608ce93d8d41ffeb6b9e65 | /rocon_python_comms/src/rocon_python_comms/service_pair_server.py | 8263080327cd5dc872bcd1d3fefb91715b3bd6bf | [] | no_license | robotics-in-concert/rocon_tools | cdfc4ccfc04b79262fb151640966a33bd0b5f498 | 1f182537b26e8622eefaf6737d3b3d18b1741ca6 | refs/heads/devel | 2021-01-17T01:58:12.163878 | 2018-02-06T15:20:29 | 2018-02-06T15:20:29 | 15,774,638 | 7 | 22 | null | 2017-08-16T06:39:47 | 2014-01-09T18:02:42 | Python | UTF-8 | Python | false | false | 6,195 | py | #
# License: BSD
# https://raw.github.com/robotics-in-concert/rocon_tools/license/LICENSE
#
##############################################################################
# Description
##############################################################################
"""
.. module:: service_pair_server
:platform: Uni... | [
"d.stonier@gmail.com"
] | d.stonier@gmail.com |
e22da16a3630862721200de043c23202f838489d | e906fe8237e5b55b7bef1f7a87884c5924ccd8b1 | /contactmps/migrations/0024_committee.py | b8cb77c7198df94f7b6f8955173bff4743b0fb99 | [
"MIT"
] | permissive | OpenUpSA/contact-mps | ac9a88ef166769d6305e213f3d77191f385c962a | 63d7f86e1b6c9319a4d0344a6125cd22770f34c7 | refs/heads/master | 2022-12-11T07:22:20.942567 | 2020-01-15T13:11:59 | 2020-01-15T13:11:59 | 93,042,651 | 0 | 2 | MIT | 2022-12-08T02:08:08 | 2017-06-01T09:52:56 | JavaScript | UTF-8 | Python | false | false | 894 | py | # -*- coding: utf-8 -*-
# Generated by Django 1.11.2 on 2018-05-14 15:42
from __future__ import unicode_literals
from django.db import migrations, models
class Migration(migrations.Migration):
dependencies = [
('contactmps', '0023_campaign_include_link_in_email'),
]
operations = [
migra... | [
"jbothma@gmail.com"
] | jbothma@gmail.com |
75204bbfc5d050883078af710ce97469e69c1335 | a089fab4b0e363ba48bff57b3948c32172570e8f | /home_connect_sdk/models/__init__.py | 311a2dad6bac50ae69888c78797c9a6745803fa0 | [] | no_license | jeroenvdwaal/home-connect-sdk | ed2e44a01b72d64d17d41af8400eb2e42792232c | 3c0ab6791bb0e9df95154f8f177d889ebef0c749 | refs/heads/master | 2022-04-23T01:20:32.621570 | 2020-04-26T09:40:16 | 2020-04-26T09:40:16 | 255,988,008 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 6,060 | py | # coding: utf-8
# flake8: noqa
"""
Home Connect API
This API provides access to home appliances enabled by Home Connect (https://home-connect.com). Through the API programs can be started and stopped, or home appliances configured and monitored. For instance, you can start a cotton program on a washer and get... | [
"jeroenvdwaal@gmail.com"
] | jeroenvdwaal@gmail.com |
b67056872a7437bd215bbd55010776a5e3c4c513 | 85a9ffeccb64f6159adbd164ff98edf4ac315e33 | /pysnmp-with-texts/DECHUB900-HRIP-MIB-V3-0.py | 4affb4dd03a0dfee8d6e74ef3a888a878b9e33bf | [
"Apache-2.0",
"LicenseRef-scancode-warranty-disclaimer",
"LicenseRef-scancode-proprietary-license",
"LicenseRef-scancode-unknown-license-reference"
] | permissive | agustinhenze/mibs.snmplabs.com | 5d7d5d4da84424c5f5a1ed2752f5043ae00019fb | 1fc5c07860542b89212f4c8ab807057d9a9206c7 | refs/heads/master | 2020-12-26T12:41:41.132395 | 2019-08-16T15:51:41 | 2019-08-16T15:53:57 | 237,512,469 | 0 | 0 | Apache-2.0 | 2020-01-31T20:41:36 | 2020-01-31T20:41:35 | null | UTF-8 | Python | false | false | 11,491 | py | #
# PySNMP MIB module DECHUB900-HRIP-MIB-V3-0 (http://snmplabs.com/pysmi)
# ASN.1 source file:///Users/davwang4/Dev/mibs.snmplabs.com/asn1/DECHUB900-HRIP-MIB-V3-0
# Produced by pysmi-0.3.4 at Wed May 1 12:37:38 2019
# On host DAVWANG4-M-1475 platform Darwin version 18.5.0 by user davwang4
# Using Python version 3.7.3 ... | [
"dcwangmit01@gmail.com"
] | dcwangmit01@gmail.com |
3652f4d252652605a8f6ef2c32218b505955d203 | 627094b5e463bd113f626450eaceb01dfa4ff5d5 | /test/client/test_link_control.py | 0e4014b88ba456056e0e54eef493cfb4f701e752 | [
"MIT"
] | permissive | DaleChen0351/python-udsoncan | 49eefcb299e2a4fabe0bf168905cc86ef43d6f62 | c495e872c69c4ea05e3b477d2a1088cb83167a17 | refs/heads/master | 2020-04-20T06:10:25.252315 | 2019-03-28T07:38:17 | 2019-03-28T07:38:17 | 168,675,483 | 0 | 0 | MIT | 2019-03-28T07:38:19 | 2019-02-01T09:42:02 | Python | UTF-8 | Python | false | false | 6,890 | py | from udsoncan.client import Client
from udsoncan import services, Baudrate
from udsoncan.exceptions import *
from test.ClientServerTest import ClientServerTest
class TestLinkContorl(ClientServerTest):
def __init__(self, *args, **kwargs):
ClientServerTest.__init__(self, *args, **kwargs)
def test_linkcontrol_verif... | [
"py.lessard@gmail.com"
] | py.lessard@gmail.com |
8d838ad1b17dd0480a189e316ae027e1fd5cb5b4 | 6fa7f99d3d3d9b177ef01ebf9a9da4982813b7d4 | /LR98GCwLGYPSv8Afb_1.py | 51545319e53c872c2a1520d669972a99be80e25f | [] | no_license | daniel-reich/ubiquitous-fiesta | 26e80f0082f8589e51d359ce7953117a3da7d38c | 9af2700dbe59284f5697e612491499841a6c126f | refs/heads/master | 2023-04-05T06:40:37.328213 | 2021-04-06T20:17:44 | 2021-04-06T20:17:44 | 355,318,759 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 77 | py |
def pluralize(lst):
return {i+'s' if lst.count(i)>1 else i for i in lst}
| [
"daniel.reich@danielreichs-MacBook-Pro.local"
] | daniel.reich@danielreichs-MacBook-Pro.local |
ed64e352839fee277680c8be39d3058c38d029a5 | d570fc2e36f0842605ad6e9dda3cbd4910160a07 | /src/webdav/Resource.py | 5b3121865ca3ace9d66cf08ff6f649d0b1b59b89 | [
"ZPL-2.1"
] | permissive | zopefoundation/ZServer | 8540fc7c411a7857abf4034068f75f2f1c7ba98c | eb047c795a278c22ae77f5af4284411e4689025e | refs/heads/master | 2023-06-21T20:54:53.580461 | 2023-02-10T09:43:55 | 2023-02-10T09:43:55 | 65,092,325 | 6 | 9 | NOASSERTION | 2020-09-17T07:25:50 | 2016-08-06T16:47:48 | Python | UTF-8 | Python | false | false | 27,157 | py | ##############################################################################
#
# Copyright (c) 2002 Zope Foundation and Contributors.
#
# This software is subject to the provisions of the Zope Public License,
# Version 2.1 (ZPL). A copy of the ZPL should accompany this distribution.
# THIS SOFTWARE IS PROVIDED "AS I... | [
"hanno@hannosch.eu"
] | hanno@hannosch.eu |
3e865ff8ba54efeccf0945858bdb43e9be54a743 | 837762524db70b805fbf46f62a14be32e32dabd9 | /scripts/train.py | df35cdfb4e3c068ebba443e31d700f6c49358b2b | [
"Apache-2.0"
] | permissive | jordancaraballo/nga-deep-learning | 832e54afb978a84875d1c09a7c00055e698f2a7b | 752266ccc06efacdef2423214998ecfced7eafb7 | refs/heads/master | 2023-06-30T14:39:49.448265 | 2021-07-27T20:00:52 | 2021-07-27T20:00:52 | 343,627,410 | 23 | 4 | null | null | null | null | UTF-8 | Python | false | false | 5,992 | py | # --------------------------------------------------------------------------
# Preprocessing and dataset creation from NGA data. This assumes you provide
# a configuration file with required parameters and files.
# --------------------------------------------------------------------------
import os # sys... | [
"jordan.a.caraballo-vega@nasa.gov"
] | jordan.a.caraballo-vega@nasa.gov |
72111d9069d5463f365998e1f2428329f7f7f195 | a79ab025913ba5a96b11bd506d9915f4533f4029 | /golfProj/golf_app/templatetags/golf_extras.py | 0dd0f7aa73defb8cb95847a41ca1632adbae8a5b | [] | no_license | jflynn87/golf_game | 2533548b1b8313661216446ddfa7927b63717118 | a24f710fbc39d25cc93b5b4c5c4d6575ef38c6bb | refs/heads/master | 2022-07-11T00:27:46.765936 | 2019-04-17T03:07:45 | 2019-04-17T03:07:45 | 174,344,305 | 0 | 0 | null | 2022-07-06T20:01:36 | 2019-03-07T12:57:45 | Python | UTF-8 | Python | false | false | 1,733 | py | from django import template
from golf_app.models import Picks, mpScores, Field, Tournament, Group
from django.db.models import Count
register = template.Library()
@register.filter
def model_name(obj):
return obj._meta.verbose_name
@register.filter
def currency(dollars):
dollars = int(dollars)
return '$'... | [
"jflynn87@hotmail.com"
] | jflynn87@hotmail.com |
43897fd79e93876b6bb01c316ff69f8ac715aa83 | 4de0c6d3a820d7669fcef5fd035416cf85b35f23 | /ITcoach/爬虫课件/第三章：数据解析/6.xpath解析案例-58二手房.py | d01d163b95860803cf0863b3b681c3a5e230439b | [
"AFL-3.0"
] | permissive | ww35133634/chenxusheng | 5e1b7391a94387b73bcd7c4d12f1247b79be8016 | 666e0eb3aedde46342faf0d4030f5c72b10c9732 | refs/heads/master | 2022-11-12T03:46:47.953680 | 2020-07-02T20:50:56 | 2020-07-02T20:50:56 | 275,168,080 | 0 | 0 | AFL-3.0 | 2020-07-02T20:58:37 | 2020-06-26T13:54:48 | HTML | UTF-8 | Python | false | false | 800 | py | #!/usr/bin/env python
# -*- coding:utf-8 -*-
import requests
from lxml import etree
#需求：爬取58二手房中的房源信息
if __name__ == "__main__":
headers = {
'User-Agent':'Mozilla/5.0 (Macintosh; Intel Mac OS X 10_12_0) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/73.0.3683.103 Safari/537.36'
}
#爬取到页面源码数据
url ... | [
"82516351@qq.com"
] | 82516351@qq.com |
04e63b41a7f0e2b684daa0deadb5d48becf59923 | 8fd2e5d53d7a91d35288ccefdb0c7ef00d927a0a | /book_06_Python黑帽子/Chapter03/网口嗅探多网段版(Bug).py | a690d64efc8c84b89fe615b495c918e4ec44349e | [] | no_license | atlasmao/Python-book-code | 03501f9ca2e81bc1f47464b3227c7f9cda0d387c | 03b6848a15a7e4c2ffebdc3528c24a8b101d9f41 | refs/heads/master | 2022-01-06T23:45:21.951307 | 2019-07-11T10:32:22 | 2019-07-11T10:32:22 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 4,745 | py | #!/usr/bin/env python2
# -*- coding: utf-8 -*-
import socket
import os
import struct
import threading
import time
from netaddr import IPNetwork, IPAddress
from ctypes import *
# 监听的主机
host = '10.0.76.1'
# 扫描的目标子网
subnet = '10.0.10.0/24'
subnet_list = []
host_up_num = 0
# 自定义的字符串， 我们将在 ICMP 响应中进行核对
magic_message = "... | [
"justsweetpotato@gmail.com"
] | justsweetpotato@gmail.com |
6a05561304bd78df0efc71b62b3659469610fd24 | f38193df76e7f86ad4017ec62dd7c90ce92e9b91 | /_src/om2py3w/3wex0/diary-server.py | 20b7585eed6f3dee62bf2c7213284c338396cdce | [
"MIT"
] | permissive | isynch/OMOOC2py | dcf54f9d2012d018c3b280d28d65058e6ae1dc08 | cc7fafc106b56553306988d07f0a4ab61bc39201 | refs/heads/master | 2020-04-25T23:30:15.410512 | 2015-12-05T07:31:56 | 2015-12-05T07:31:56 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,220 | py | # -*- coding: utf-8 -*-
from datetime import datetime
import socket
import sys
HOST = '' # Symbolic name meaning all available interfaces
PORT = 1234 # Arbitary non-privileged port
# Datagram(udp) socket
try:
s=socket.socket(socket.AF_INET,socket.SOCK_DGRAM)
print '创建中...'
except socket.error, msg:
print... | [
"dadac123@gmail.com"
] | dadac123@gmail.com |
49f7dbbdfffd887a721bcc1a2ee1ced7e8de18d3 | 26bd175ffb3bd204db5bcb70eec2e3dfd55fbe9f | /exercises/networking_selfpaced/networking-workshop/collections/ansible_collections/community/general/plugins/modules/network/netvisor/pn_cpu_class.py | fadbed03e41b7d154a3530d1d8ce9f13d78ed446 | [
"MIT",
"GPL-3.0-only",
"GPL-3.0-or-later",
"CC0-1.0",
"GPL-1.0-or-later"
] | permissive | tr3ck3r/linklight | 37814ed19173d893cdff161355d70a1cf538239b | 5060f624c235ecf46cb62cefcc6bddc6bf8ca3e7 | refs/heads/master | 2021-04-11T04:33:02.727318 | 2020-03-25T17:38:41 | 2020-03-25T17:38:41 | 248,992,437 | 0 | 0 | MIT | 2020-03-21T14:26:25 | 2020-03-21T14:26:25 | null | UTF-8 | Python | false | false | 5,894 | py | #!/usr/bin/python
# Copyright: (c) 2018, Pluribus Networks
# GNU General Public License v3.0+ (see COPYING or https://www.gnu.org/licenses/gpl-3.0.txt)
from __future__ import absolute_import, division, print_function
__metaclass__ = type
ANSIBLE_METADATA = {'metadata_version': '1.1',
'status': ['... | [
"joshuamadison+gh@gmail.com"
] | joshuamadison+gh@gmail.com |
dfeaef8960d9c3c78351dc377c9805836cc90639 | 69cfe57220f789eb1d1966ed22c6823f0beeb8ce | /covid_venv/lib/python3.7/site-packages/dash_html_components/Pre.py | 46214932ac801cfab78d16fc03ee6f01f0cbd582 | [
"MIT"
] | permissive | paulsavala/Covid19-model | 664e31780ee1c8e4ef2115af2f41b27e832e5e50 | 41aa96d7c9abc117550f904af11815f507f0f0a0 | refs/heads/master | 2022-07-15T17:39:05.842619 | 2020-11-16T20:42:22 | 2020-11-16T20:42:22 | 252,545,888 | 2 | 0 | MIT | 2022-06-22T01:37:35 | 2020-04-02T19:19:25 | Python | UTF-8 | Python | false | false | 4,767 | py | # AUTO GENERATED FILE - DO NOT EDIT
from dash.development.base_component import Component, _explicitize_args
class Pre(Component):
"""A Pre component.
Pre is a wrapper for the <pre> HTML5 element.
For detailed attribute info see:
https://developer.mozilla.org/en-US/docs/Web/HTML/Element/pre
Keyword arguments:
-... | [
"paulsavala@gmail.com"
] | paulsavala@gmail.com |
95e81629ec5b165d02943f34a71fc1f1080bcef5 | cfb4e8721137a096a23d151f2ff27240b218c34c | /mypower/matpower_ported/mp-opt-model/lib/@opt_model/solve.py | 4ebc7aba4174ad01cb668380102ca885eae9fb2c | [
"Apache-2.0"
] | permissive | suryo12/mypower | eaebe1d13f94c0b947a3c022a98bab936a23f5d3 | ee79dfffc057118d25f30ef85a45370dfdbab7d5 | refs/heads/master | 2022-11-25T16:30:02.643830 | 2020-08-02T13:16:20 | 2020-08-02T13:16:20 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 146 | py | def solve(*args,nout=5,oc=None):
if oc == None:
from .....oc_matpower import oc_matpower
oc = oc_matpower()
return oc.solve(*args,nout=nout)
| [
"muhammadyasirroni@gmail.com"
] | muhammadyasirroni@gmail.com |
3c6dc99ca36a539efb2e696f6b57cbd205a83f8b | ae7ba9c83692cfcb39e95483d84610715930fe9e | /baidu/Paddle/paddle/trainer/tests/config_parser_test.py | 5ca874cec7914a20f79c2c7b1873c5bd04f60dca | [
"Apache-2.0"
] | permissive | xenron/sandbox-github-clone | 364721769ea0784fb82827b07196eaa32190126b | 5eccdd8631f8bad78eb88bb89144972dbabc109c | refs/heads/master | 2022-05-01T21:18:43.101664 | 2016-09-12T12:38:32 | 2016-09-12T12:38:32 | 65,951,766 | 5 | 7 | null | null | null | null | UTF-8 | Python | false | false | 1,002 | py | # Copyright (c) 2016 Baidu, Inc. All Rights Reserved
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law o... | [
"xenron@outlook.com"
] | xenron@outlook.com |
1f4e873eab2fcd41f293bcb80c7e8ae1e5eb4377 | 0019ea5621577ab9a9a694e3ef91d913e981a28e | /missing_data_complementor/__init__.py | 47ea50802fb334e4e0fffda9b4c61d9c2aa1527b | [] | no_license | sungc1/fake-news-framework_Py3 | 676710b3bf7b8feb4c237ffed7d1d280f4967890 | e3552b5bc2a30dbd52ad893ce8dd29aa2242f864 | refs/heads/main | 2023-01-19T23:42:13.294446 | 2020-12-01T18:38:31 | 2020-12-01T18:38:31 | 428,178,049 | 1 | 0 | null | 2021-11-15T08:18:23 | 2021-11-15T08:18:23 | null | UTF-8 | Python | false | false | 47 | py | #
# Created by Aviad on 03-Jun-16 11:40 AM.
# | [
"aviade@post.bgu.ac.il"
] | aviade@post.bgu.ac.il |
7d8115df6fa61bc6f721bc8db8bd47858dc75982 | e3365bc8fa7da2753c248c2b8a5c5e16aef84d9f | /indices/primu.py | 74ed5f7f4b48b1b61044808885c34bd9dce48229 | [] | no_license | psdh/WhatsintheVector | e8aabacc054a88b4cb25303548980af9a10c12a8 | a24168d068d9c69dc7a0fd13f606c080ae82e2a6 | refs/heads/master | 2021-01-25T10:34:22.651619 | 2015-09-23T11:54:06 | 2015-09-23T11:54:06 | 42,749,205 | 2 | 3 | null | 2015-09-23T11:54:07 | 2015-09-18T22:06:38 | Python | UTF-8 | Python | false | false | 255 | py | ii = [('WilbRLW.py', 1), ('WilkJMC3.py', 3), ('ClarGE2.py', 2), ('GellWPT2.py', 1), ('WilkJMC2.py', 1), ('LyelCPG.py', 1), ('SoutRD.py', 3), ('WilkJMC.py', 3), ('WestJIT.py', 1), ('FitzRNS.py', 1), ('DibdTRL.py', 1), ('EvarJSP.py', 1), ('SadlMLP2.py', 1)] | [
"prabhjyotsingh95@gmail.com"
] | prabhjyotsingh95@gmail.com |
ae27520913674390e809620c54463d13c4e88d63 | 8afb5afd38548c631f6f9536846039ef6cb297b9 | /GIT-USERS/TOM-Lambda/CS35_IntroPython_GP/day3/intro/11_args.py | 2ec2eca832f454921138650bfb137e422a0c4711 | [
"MIT"
] | permissive | bgoonz/UsefulResourceRepo2.0 | d87588ffd668bb498f7787b896cc7b20d83ce0ad | 2cb4b45dd14a230aa0e800042e893f8dfb23beda | refs/heads/master | 2023-03-17T01:22:05.254751 | 2022-08-11T03:18:22 | 2022-08-11T03:18:22 | 382,628,698 | 10 | 12 | MIT | 2022-10-10T14:13:54 | 2021-07-03T13:58:52 | null | UTF-8 | Python | false | false | 2,852 | py | # Experiment with positional arguments, arbitrary arguments, and keyword
# arguments.
# Write a function f1 that takes two integer positional arguments and returns
# the sum. This is what you'd consider to be a regular, normal function.
<<<<<<< HEAD
def f1(a, b):
return a + b
=======
def f1(a, b):
return a + b... | [
"bryan.guner@gmail.com"
] | bryan.guner@gmail.com |
7accaa8ad9e3c45b158dd9537e55e683338dea29 | 70e1159856750f04e58c0ffc3f54d094a4602c07 | /booktest/views.py | 84958fd19d5631e83ebfd2b20bac16190adc186f | [] | no_license | wxp19940506/django_test | 032e78a4eb45eb0c54dbafd43dfd0e463d455bb5 | c586cb62d1bb1a21f3430155b3d82ab7b2a65da6 | refs/heads/master | 2021-05-10T11:52:54.186422 | 2018-01-22T07:55:11 | 2018-01-22T07:55:11 | 118,424,555 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 605 | py | from django.shortcuts import render
from django.http import *
from django.template import RequestContext,loader
from .models import *
# Create your views here.
def index(request):
# temp = loader.get_template("booktest/index.html")
#
# return HttpResponse(temp.render())
booklist = BookInfo.objects.all... | [
"xwp_fullstack@163.com"
] | xwp_fullstack@163.com |
e7fc2c8eede38ab1d057f2930410a29a6191871a | f14946892dcc62732cffd0dba364d2098e6de607 | /converter.py | 40fb58d5f55a79226720f093675f16897083b36c | [] | no_license | DollaR84/notes | 556368c12b0ead9901b05b95a5691138b588eb86 | a74ec7cf41b842501d1c24ec3b180d76be1fbef1 | refs/heads/master | 2023-03-26T21:04:37.415037 | 2020-06-18T14:11:15 | 2020-06-18T14:11:15 | 223,773,925 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 7,300 | py | """
Converter database from old versions to new.
Created on 19.04.2020
@author: Ruslan Dolovanyuk
"""
from copy import deepcopy
from datetime import datetime
import os
from database import Database
import tables
import updates
class DBConverter:
"""Converter database on new update versions."""
def __i... | [
"cooler84@ukr.net"
] | cooler84@ukr.net |
8ef6b58674a55f6236df4da9f882ab9310c12fb8 | f82757475ea13965581c2147ff57123b361c5d62 | /gi-stubs/repository/GstGL/GLMemoryAllocatorClass.py | 09d94c14d0970b096b8877bf3ada06ef684d53ce | [] | no_license | ttys3/pygobject-stubs | 9b15d1b473db06f47e5ffba5ad0a31d6d1becb57 | d0e6e93399212aada4386d2ce80344eb9a31db48 | refs/heads/master | 2022-09-23T12:58:44.526554 | 2020-06-06T04:15:00 | 2020-06-06T04:15:00 | 269,693,287 | 8 | 2 | null | 2020-06-05T15:57:54 | 2020-06-05T15:57:54 | null | UTF-8 | Python | false | false | 5,176 | py | # encoding: utf-8
# module gi.repository.GstGL
# from /usr/lib64/girepository-1.0/GstGL-1.0.typelib
# by generator 1.147
"""
An object which wraps an introspection typelib.
This wrapping creates a python module like representation of the typelib
using gi repository as a foundation. Accessing attributes of the ... | [
"ttys3@outlook.com"
] | ttys3@outlook.com |
8a344aae06dbeb32785b94bf82c33c8f84c20b41 | 55d13d3e41d8651facf7c26d60de5e8b8ace4be5 | /piedpiper/crab/multicrab-0.py | ac77e6ce915307348ba0838f04a1b7373744c932 | [] | no_license | phylsix/Firefighter | e8ab5fdbde2dab341a67740aa62c5710683e9bab | 8f1d8d6e59b443a8216c70ebdd334b48945aeed0 | refs/heads/master | 2020-12-19T18:31:14.312639 | 2020-08-04T00:35:45 | 2020-08-04T00:35:45 | 235,812,142 | 0 | 1 | null | null | null | null | UTF-8 | Python | false | false | 4,190 | py | #!/usr/bin/env python
from __future__ import print_function
import os
import sys
import time
from os.path import basename, join
import yaml
from CRABAPI.RawCommand import crabCommand
from crabConfig_0 import *
from Firefighter.piedpiper.utils import *
verbose = False
alwaysDoCmd = True
if os.environ["CMSSW_BASE"] n... | [
"weinan.si@cern.ch"
] | weinan.si@cern.ch |
aa36fc5578e1ff9d3e2ca3774590d9e2ac4b034b | 353def93fa77384ee3a5e3de98cfed318c480634 | /.history/week01/hoework01/gettop10frommaoyam01_20200626091702.py | d2722f72cb3c318b6baafd5cd7fd7285bc7c6d98 | [] | no_license | ydbB/Python001-class01 | d680abc3ea1ccaeb610751e3488421417d381156 | ad80037ccfc68d39125fa94d2747ab7394ac1be8 | refs/heads/master | 2022-11-25T11:27:45.077139 | 2020-07-19T12:35:12 | 2020-07-19T12:35:12 | 272,783,233 | 0 | 0 | null | 2020-06-16T18:28:15 | 2020-06-16T18:28:15 | null | UTF-8 | Python | false | false | 2,407 | py | # 使用requests，bs4库，爬取猫眼电影top10的电影名称、电影类型、上映时间，并以utf-8的字符集保存到csv文件中
import requests
from bs4 import BeautifulSoup as bs
maoyanUrl = "https://maoyan.com/board/4";
user_agent = 'Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/74.0.3729.169 Safari/537.36'
header = {
'Conten... | [
"31039587+ydbB@users.noreply.github.com"
] | 31039587+ydbB@users.noreply.github.com |
03622786a4de2d5c12beee1a16d5fba75dcf2347 | 29ad9caf139fab91580d7be36c9bd07623c4ca4d | /py/edu_freq_min.py | fc3b361beeafe60bea31d57a072936492e1f99f0 | [
"Apache-2.0",
"LicenseRef-scancode-unknown-license-reference",
"LicenseRef-scancode-unknown"
] | permissive | bcgov/flatfile-tools | f324687389a508aad641131f70bb66c533917bbe | 749071129cab7a598bd4c2edf050dce59324a97f | refs/heads/master | 2021-06-10T15:14:08.266856 | 2021-05-13T14:23:48 | 2021-05-13T14:23:48 | 183,680,156 | 2 | 0 | Apache-2.0 | 2020-04-15T02:21:47 | 2019-04-26T18:58:46 | Python | UTF-8 | Python | false | false | 3,247 | py | # 20190315 take pharmanet dispensations, look for earliest dispense date of drug type, as well as dispense frequency
# output has same data, with freq and min_srv_date added
import os
import sys
import time
from misc import*
def expected(f_name, lookup):
if f_name not in lookup:
err("expected field: " + st... | [
"richardson.ashlin@gmail.com"
] | richardson.ashlin@gmail.com |
e0887b70f4b7024270a588e59d6a5d81ec0959c3 | 48e124e97cc776feb0ad6d17b9ef1dfa24e2e474 | /sdk/python/pulumi_azure_native/signalrservice/v20210601preview/get_signal_r.py | e126d745e3c8f5f3fc1a5876c117c9fc8754627f | [
"BSD-3-Clause",
"Apache-2.0"
] | permissive | bpkgoud/pulumi-azure-native | 0817502630062efbc35134410c4a784b61a4736d | a3215fe1b87fba69294f248017b1591767c2b96c | refs/heads/master | 2023-08-29T22:39:49.984212 | 2021-11-15T12:43:41 | 2021-11-15T12:43:41 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 16,073 | py | # coding=utf-8
# *** WARNING: this file was generated by the Pulumi SDK Generator. ***
# *** Do not edit by hand unless you're certain you know what you are doing! ***
import warnings
import pulumi
import pulumi.runtime
from typing import Any, Mapping, Optional, Sequence, Union, overload
from ... import _utilities
fro... | [
"noreply@github.com"
] | bpkgoud.noreply@github.com |
c8705454f5b80ca5aca9c2228cd462665605112d | f8e03a0724516b7cc2299f6c7a8cef544fa32484 | /source/pic2card/mystique/group_design_objects.py | e59231d840bf9b34a839f234137c4999867a8772 | [
"MIT"
] | permissive | isabella232/AdaptiveCards | cc3904f0782bd94087ae0a0df0ee2db954facdde | 766750517196d05f4466941647e07a8a298257b2 | refs/heads/main | 2023-03-07T22:13:55.327587 | 2020-11-17T02:02:15 | 2020-11-17T02:02:15 | 313,699,024 | 0 | 0 | MIT | 2021-02-23T16:14:48 | 2020-11-17T17:51:17 | null | UTF-8 | Python | false | false | 21,437 | py | """Module for grouping deisgn objects into different containers"""
from operator import itemgetter
from typing import List, Dict, Callable, Tuple, Optional
from mystique import config
from mystique.extract_properties import CollectProperties
class GroupObjects:
"""
Handles the grouping of given list of objec... | [
"noreply@github.com"
] | isabella232.noreply@github.com |
fedf9a4adf68e18a4d492e204426b009e4c03540 | 299c07abf832ba8b0a4181c526f95d6f861c3623 | /pages/views.py | 483e3caba3bab343c52bb5dfe15734215146eb40 | [] | no_license | ananyajana/hello-world | 37640880b8df2b170a4d64a7893eced35cf07293 | c498ec70016e22978f2c3f0365d6a38522254b72 | refs/heads/master | 2023-08-14T22:52:25.634216 | 2020-05-25T11:38:28 | 2020-05-25T11:38:28 | 266,763,806 | 0 | 0 | null | 2021-09-22T19:09:50 | 2020-05-25T11:39:56 | Python | UTF-8 | Python | false | false | 166 | py | from django.shortcuts import render
from django.http import HttpResponse
# Create your views here.
def homePageView(request):
return HttpResponse('Hello, World!')
| [
"ananya.jana@gmail.com"
] | ananya.jana@gmail.com |
5504d599f5231dfb970d783217327010a3757c72 | e5e2b7da41fda915cb849f031a0223e2ac354066 | /sdk/python/pulumi_azure_native/netapp/v20201201/snapshot.py | 5dc6e64c2d7c5f24cdb196fcb956b80495f2cc6e | [
"BSD-3-Clause",
"Apache-2.0"
] | permissive | johnbirdau/pulumi-azure-native | b7d3bdddeb7c4b319a7e43a892ddc6e25e3bfb25 | d676cc331caa0694d8be99cb90b93fa231e3c705 | refs/heads/master | 2023-05-06T06:48:05.040357 | 2021-06-01T20:42:38 | 2021-06-01T20:42:38 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 12,959 | py | # coding=utf-8
# *** WARNING: this file was generated by the Pulumi SDK Generator. ***
# *** Do not edit by hand unless you're certain you know what you are doing! ***
import warnings
import pulumi
import pulumi.runtime
from typing import Any, Mapping, Optional, Sequence, Union, overload
from ... import _utilities
__... | [
"noreply@github.com"
] | johnbirdau.noreply@github.com |
e1ca10f66fe6e4a01b92ace526335679d0427751 | 42f4238073a70d1494537f8c8b07835b531e73a9 | /benchmarks/beach/redist_beach_erosion_board_waves_3d_c0p1_n.py | e0d724264d63efa1c4516fe87fb96968f2ac296f | [] | no_license | erdc/proteus-mprans | bd99257af7b3bbe08386533faf072dba22e93a61 | f8f4d20bc870b361c64c8ca2ceb99f045b373323 | refs/heads/master | 2022-09-11T13:18:39.973962 | 2022-08-11T16:27:29 | 2022-08-11T16:27:29 | 2,303,947 | 3 | 1 | null | null | null | null | UTF-8 | Python | false | false | 2,767 | py | from proteus import *
from proteus.default_n import *
from redist_beach_erosion_board_waves_3d_p import *
from beach_erosion_board_waves_3d import *
if rdtimeIntegration == 'newton':
timeIntegration = NoIntegration
stepController = Newton_controller
elif rdtimeIntegration == 'tte':
timeIntegration = Ba... | [
"cekees@gmail.com"
] | cekees@gmail.com |
2c730e56bc9a5b4983cd6e076bc899c0964737a6 | 58e15fca047ece58bfa391a6efb88ec1b46997b2 | /venv/lib/python3.8/site-packages/selenium/webdriver/common/actions/wheel_input.py | 64bb6db22df1194f5b148b59bd4fabff2289bdc4 | [] | no_license | su2708/WebScraper | 6594f102336de0bb0ebc2c3feafdb4d87da52ad3 | a084afce4a8dacb4d4beb43924aa85a831c3b4ec | refs/heads/main | 2023-02-20T15:43:37.246448 | 2023-01-15T17:26:28 | 2023-01-15T17:26:28 | 323,025,342 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 96 | py | /home/runner/.cache/pip/pool/f6/5c/a4/99012d79ffc30cf1b681f61f329c7ebd8c280d8c5fcc537385cf91bd63 | [
"46125751+su2708@users.noreply.github.com"
] | 46125751+su2708@users.noreply.github.com |
9dca95f0eadc9b7576cb73579313ffa2ab36aaa3 | 444670e6d73ae9d95c0bb0459c8e02423876d2fb | /pycharm/LoginSite/mylogin/migrations/0001_initial.py | 08c4cb3c5cfd13d3c86c5e92dc2a59b4d175f342 | [] | no_license | zhangxingxing12138/web-pycharm | c8b6822be95bfb904f81f772185fe9e17fc77fc3 | 5f212e6805b0734aa3c791830526a95b24a930f4 | refs/heads/master | 2020-04-04T18:03:45.458309 | 2018-11-08T12:03:51 | 2018-11-08T12:03:51 | 156,148,231 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,056 | py | # -*- coding: utf-8 -*-
# Generated by Django 1.11 on 2018-11-06 00:45
from __future__ import unicode_literals
from django.db import migrations, models
class Migration(migrations.Migration):
initial = True
dependencies = [
]
operations = [
migrations.CreateModel(
name='User',
... | [
"you@example.com"
] | you@example.com |
450e45abb2e6f78121b9289dfc49ce668ece839a | 5fa293d0ef6f3bdc4791d869cf503b107cc3a5fb | /soap_client/urls.py | 5e70df6a51ac6d70d04e1a6e01da2fd63ec1b6aa | [
"MIT"
] | permissive | alldevic/nav_info | 0779ab116dd7718ac1d63fecfbc2d47dd8863c22 | 32681d1cd3ad43472c8f7fb49922094c4045111c | refs/heads/master | 2023-08-27T00:23:57.233994 | 2021-11-05T15:24:48 | 2021-11-05T15:24:48 | 278,404,502 | 0 | 0 | MIT | 2021-11-05T15:24:49 | 2020-07-09T15:37:41 | Python | UTF-8 | Python | false | false | 317 | py | from django.urls import path, include
from rest_framework.routers import DefaultRouter
from soap_client import views
router = DefaultRouter()
router.register('raw', views.RawViewSet, basename='raw')
router.register('data', views.DataViewSet, basename='data')
urlpatterns = [
path('', include(router.urls)),
]
| [
"belyynikolay@gmail.com"
] | belyynikolay@gmail.com |
1a71d1d48c8c1e7899c78ae5ffffd819170fff8b | 0c5fed6415f7a307d0885d7579969d4e8f0121c8 | /Assignements/MT17143_Assignment5&6/MT17143_Problem1.py | fb5a51bc4753c66cf95906fd1944be7a9261bf8c | [] | no_license | akshitasawhney3008/Machine-Learning | 4032dfb3efaa7fdeb794913bb30e39f7a2fece31 | bef1672ecb51e07b291349af9df219d2bfea8f2d | refs/heads/master | 2023-02-02T16:22:01.016505 | 2020-12-10T10:37:49 | 2020-12-10T10:37:49 | 320,232,766 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 3,121 | py | #MT17143 Akshita Sawhney
#Problem 1 RNA Sequencing
from sklearn.metrics import accuracy_score
from sklearn.cross_validation import train_test_split
from sklearn.cluster import KMeans
from sklearn.cluster import MiniBatchKMeans
from sklearn.cluster import SpectralClustering
from sklearn.manifold import TSNE
from sklear... | [
"akshita17143@iiitd.ac.in"
] | akshita17143@iiitd.ac.in |
b3953b62fa3db6523934640dd6efa14908a3bbea | c5744c2fda48ae6a79c155c641fe98021a0cb7f3 | /PP4E/System/setenv.py | a03d7c04233f64c0efbc11ad24b5bc1eaace0f37 | [] | no_license | skinkie/Scripts | e0fd3d3f767612ade111f28bc7af3e1b25fc2947 | 80a1ba71ddf9a0c5ff33866832cb5c42aca0c0b1 | refs/heads/master | 2021-05-31T16:57:21.100919 | 2016-05-23T09:58:59 | 2016-05-23T09:58:59 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 299 | py | #!/usr/bin/env python
# eg. 3-3
import os
print('setenv...', end=' ')
print(os.environ['USER'])
os.environ['USER'] = 'Brian'
os.system('python echoenv.py')
os.environ['USER'] = 'Arthur'
os.system('python echoenv.py')
os.environ['USER'] = input('?')
print(os.popen('python3.5 echoenv.py').read()) | [
"death_finger@sina.com"
] | death_finger@sina.com |
fb602658c47b01a30ff2c7ae2b51eec8b1d10712 | faf2b052e7f8cd79467ad34fbc173f3bf4b1a21d | /test/test_ws_equipment_list_result.py | 7230f7e81388c99a49ad58906a36598acb75af45 | [] | no_license | atbe/MSU-Scholar-Api-Client-Python | 5d39577ce07ab285f0df9ee58a1ed7ff8ab08d2a | 31b263e5ad848fc6593c4662fbf2828ab9e2594c | refs/heads/master | 2021-05-04T00:51:46.720474 | 2018-03-12T23:52:17 | 2018-03-12T23:52:17 | 120,354,270 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,853 | py | # coding: utf-8
"""
PURE API 510
This is the Pure Web Service. Listed below are all available endpoints, along with a short description.<br/>In order to use the Pure Web Service, you must enter an API key. These are generated in the Administrator tab of Pure, and issues with a given set of available endpoints... | [
"abeahmed2@gmail.com"
] | abeahmed2@gmail.com |
dc68438bc369293cbf262f10722059dbc20ee2e8 | 57094f0d09fd3e74eeb511e94400c3ec97051ad3 | /Quax_dev_archive/quax_misc/angular_momentum/tensor_approach/contracted/contracted_overlap.py | 1d41836be55f7685a172233f95c91a9581ffd5c8 | [] | no_license | adabbott/Research_Notes | cccba246e81065dc4a663703fe225fc1ebbf806b | 644394edff99dc6542e8ae6bd0ce8bcf158cff69 | refs/heads/master | 2023-05-12T20:26:58.938617 | 2021-06-02T17:15:35 | 2021-06-02T17:15:35 | 119,863,228 | 1 | 0 | null | null | null | null | UTF-8 | Python | false | false | 13,501 | py | import jax
import jax.numpy as np
import numpy as onp
from jax.config import config; config.update("jax_enable_x64", True)
np.set_printoptions(precision=10)
onp.set_printoptions(precision=10)
def double_factorial(n):
'''The double factorial function for small Python integer `n`.'''
return np.prod(np.arange(n, ... | [
"adabbott@uga.edu"
] | adabbott@uga.edu |
945d9be3f8c30181dec6d9d90930e60f95885cd4 | b36d169e1353752486441636255d435568ca307d | /spikeforest/forestview/spikeforest_view_launchers.py | 799752c978e88f723fc1bfd9313fe29c641c09d9 | [
"Apache-2.0"
] | permissive | alexmorley/spikeforest2 | 5d211595f744ed755eea9b9376e31ed6f9a4da12 | 859fc8b843cc7b547ab83d3e0a43bb17230d09b1 | refs/heads/master | 2020-04-23T03:40:08.076097 | 2019-06-12T08:11:06 | 2019-06-12T08:11:06 | 170,885,069 | 0 | 0 | null | 2019-02-15T15:21:47 | 2019-02-15T15:21:46 | null | UTF-8 | Python | false | false | 11,809 | py | from .spikeforest_views.currentstateview import CurrentStateView
from .spikeforest_views.recordingtableview import RecordingTableView, RecordingSelectComponent
from .spikeforest_views.aggregatedsortingresultstableview import AggregatedSortingResultsTableView
from .recording_views.electrodegeometryview import ElectrodeG... | [
"jeremy.magland@gmail.com"
] | jeremy.magland@gmail.com |
607f0c745c7df74bf1cbfc3ebac73ac5b92debb3 | 8d03310627f1f625eddda8f4a3e680892872e0ec | /batemaneq/__init__.py | 09ee7bcfa329b2d98875fd9beb5ea50bbdbf1f40 | [
"LicenseRef-scancode-unknown-license-reference",
"BSD-2-Clause"
] | permissive | Rolleroo/batemaneq | 4da15e4bff32484d27ea9dc2b3338edc4956b0df | bd8c24d1f77ccb166b3210d81d9468f7789813ad | refs/heads/master | 2021-02-05T12:43:40.639427 | 2020-02-23T20:47:48 | 2020-02-23T20:47:48 | 243,781,711 | 1 | 0 | BSD-2-Clause | 2020-02-28T14:31:36 | 2020-02-28T14:31:36 | null | UTF-8 | Python | false | false | 356 | py | # -*- coding: utf-8 -*-
"""
batemaneq provides a Python package for evaluating the Bateman equation
"""
from __future__ import absolute_import
from ._release import __version__
from .bateman import bateman_parent, bateman_full
from ._bateman_double import bateman_parent as bateman_parent_arr
from ._bateman_double impo... | [
"bjodah@gmail.com"
] | bjodah@gmail.com |
d1be16162f4ac7c7277b10428e050b2deff850ea | ef18d99eff01a708dddfc2cbf77f68bb1d8aa889 | /python/415.add-strings.py | 0d3f611c808e58d327f44045f8c4f9a31bc6f054 | [
"MIT"
] | permissive | fengbaoheng/leetcode | 53d5b6f92f7958d551e6297f77c4edfc042a4d58 | e37535a06b0b4cb23de9a2cfa357eb689b1c06fb | refs/heads/master | 2023-07-23T11:33:42.938862 | 2023-07-08T08:43:46 | 2023-07-08T08:43:46 | 131,551,048 | 1 | 0 | MIT | 2022-11-16T02:53:49 | 2018-04-30T03:13:55 | Java | UTF-8 | Python | false | false | 1,582 | py | #
# @lc app=leetcode.cn id=415 lang=python3
#
# [415] 字符串相加
#
class Solution:
# 字符串拆分为链表或数组,逐位相加
# 直接转成数字会超出最大整数范围
def addStrings(self, num1: str, num2: str) -> str:
short_num, long_num = (num1, num2) if len(num1) < len(num2) else (num2, num1)
short_length = len(short_num)
long_leng... | [
"344092466@qq.com"
] | 344092466@qq.com |
ff82dba0faaadec9068bbc9b3ccc625a721573a6 | 786027545626c24486753351d6e19093b261cd7d | /ghidra9.2.1_pyi/ghidra/file/formats/gzip/GZipFileSystemFactory.pyi | 65e1831d93c9e7d26029af1620bb52a08cc18eb9 | [
"MIT"
] | permissive | kohnakagawa/ghidra_scripts | 51cede1874ef2b1fed901b802316449b4bf25661 | 5afed1234a7266c0624ec445133280993077c376 | refs/heads/main | 2023-03-25T08:25:16.842142 | 2021-03-18T13:31:40 | 2021-03-18T13:31:40 | 338,577,905 | 14 | 1 | null | null | null | null | UTF-8 | Python | false | false | 1,302 | pyi | from typing import List
import ghidra.formats.gfilesystem
import ghidra.formats.gfilesystem.factory
import ghidra.util.task
import java.io
import java.lang
class GZipFileSystemFactory(object, ghidra.formats.gfilesystem.factory.GFileSystemFactoryWithFile, ghidra.formats.gfilesystem.factory.GFileSystemProbeBytesOnly):
... | [
"tsunekou1019@gmail.com"
] | tsunekou1019@gmail.com |
1fa034f767ef9f88cf6992b4ac2982972c7b0b5f | ca61296e18ae834628b6a4199bbd5a9379bdeff3 | /worker/models.py | 0cd8b2b7d891bed8050b7ab22c805edc0417230a | [] | no_license | shashank-sharma/gdrs | 8979361a21a01097ca9f5a9e969c55c8548fedfa | b0cb17eade5049b5175dc78eb93b0385b72ac61a | refs/heads/master | 2020-03-29T22:41:18.934031 | 2019-01-22T15:31:31 | 2019-01-22T15:31:31 | 150,435,096 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,181 | py | from django.db import models
from accounts.models import User
# Create your models here.
class Driver(models.Model):
user = models.ForeignKey(User, on_delete=models.CASCADE)
driving_licence_number = models.CharField(max_length=20)
expiry_date = models.DateField()
working = models.BooleanField(default=F... | [
"shashank.sharma98@gmail.com"
] | shashank.sharma98@gmail.com |
7aa49d03b00df1969a441a334cfa985a4fe57e98 | e87d793b3a5facc6e54e0263fbd67703e1fbb382 | /duckietown-world-venv/lib/python3.6/site-packages/geometry/manifolds/tests/embedding_test.py | c6435354a8abc351527207b355f8785768e2ff0f | [] | no_license | llingg/behaviour-benchmarking | a860bbe709309e13f3e1133d916944882199a40f | 85bbf1a9c2c628ba74480fe7abac3804d6afdac4 | refs/heads/v1 | 2022-10-06T08:21:29.068329 | 2020-06-11T07:02:46 | 2020-06-11T07:02:46 | 259,622,704 | 0 | 0 | null | 2020-06-02T17:52:46 | 2020-04-28T11:52:08 | C++ | UTF-8 | Python | false | false | 1,989 | py | # coding=utf-8
from geometry.manifolds import (SO3, SO2, R1, R2, R3, SE2, SE3, S2, S1, T1, T2,
T3, so2, so3, se2, se3, Tran3, Tran2, Tran1, tran2, tran1, tran3)
from nose.plugins.attrib import attr
def check_embed_relation_cond(A, B):
check_embed_relation_cond.description = 'Checking %s < %s' % (A, B)
msg... | [
"linggl@student.ethz.ch"
] | linggl@student.ethz.ch |
d37a305a988762a88462d72268ef5b9960e21900 | f7e9bf6fa18a41b52994b1f16fd55c4d69f33b56 | /plugins/embed_picasaweb_image/embed_picasaweb_image.py | 02b13d5d2a5d91850ad78e166be1f0e6b52a1e0a | [
"Unlicense",
"LicenseRef-scancode-public-domain"
] | permissive | siongui/userpages | 1716f2d24e52b514ea8534027cec9707783d0d47 | 494b95e61715a49dce6615103a5b19fa05f276f1 | refs/heads/master | 2023-07-01T12:52:04.813216 | 2023-06-12T16:31:25 | 2023-06-12T16:31:25 | 13,944,800 | 80 | 39 | Unlicense | 2023-08-18T03:51:40 | 2013-10-29T02:39:13 | Go | UTF-8 | Python | false | false | 1,564 | py | #!/usr/bin/env python
# -*- coding: utf-8 -*- #
# Creating reStructuredText Directives
# @see http://docutils.sourceforge.net/docs/howto/rst-directives.html
from docutils.parsers.rst import directives, Directive
from docutils import nodes
class embed_picasaweb_image(Directive):
required_arguments = 1
optional_ar... | [
"siongui@gmail.com"
] | siongui@gmail.com |
a83aef36ff14f7c63007b1cf8d651c30aeb8ef94 | 573f85b19a687b103bf0e70b48f1eab0fbed792a | /certbot/AliDNSCertbot.py | 716f19879cb1900387314795c22cde75a263459f | [
"Apache-2.0"
] | permissive | calllivecn/dockerbuild | 7e240326743aaf88b7adc3637c8c643a8c4b7c41 | e2c2c315677d2510f806e3dfa3fec062c58c7134 | refs/heads/master | 2023-07-23T03:27:17.378620 | 2023-03-13T04:19:54 | 2023-03-13T04:19:54 | 128,035,897 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 12,289 | py | #!/usr/bin/env python3
# coding=utf-8
# date 2019-11-20 16:34:16
# author calllivecn <c-all@qq.com>
import os
import sys
import time
import base64
import hashlib
import hmac
import logging
#import configparser
import urllib
from urllib import request
from urllib import parse
# pip install alibabacloud_alidns20150... | [
"calllivecn@outlook.com"
] | calllivecn@outlook.com |
018b478deaa34ef7036f428aa0a5ce8e3ee99722 | 7f3112bd1cb6d5831370f01db1bf4ef7b9d6aee6 | /selenium/test_search_in_python_org_search.py | 43a2016183284cf053b611255f753820858169f3 | [] | no_license | insta-code1/Python-Unittests | f8a2138ae457756d8897594eaa2745a40f908a7e | 84d62edce5b929b1822d4d7a92c7edf3003ddf07 | refs/heads/master | 2020-12-25T14:59:08.705048 | 2016-09-04T12:11:22 | 2016-09-04T12:11:22 | 67,342,779 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 641 | py | import unittest
from selenium import webdriver
from selenium.webdriver.common.keys import Keys
class PythonOrgSearch(unittest.TestCase):
def setUp(self):
self.driver = webdriver.Firefox()
def test_search_in_python_org(self):
driver = self.driver
driver.get("http://www.python.org")
... | [
"eoinkane1@gmail.com"
] | eoinkane1@gmail.com |
d0684e191884794bcca60c9a003d3a736017998e | f8ece22d9e9e12e2cbca56d72a6b2728ba9a275a | /polyaxon/experiments/utils.py | 50329e5e6fe312b3cb5120c878e85833117c63a9 | [
"MIT"
] | permissive | pparan/polyaxon | 8c8912f9ba724e007357efcaefeab86fec2d5630 | 423199721e90431209b00c0f76caa6b4f9aa4b24 | refs/heads/master | 2021-04-15T07:15:19.701268 | 2018-03-21T11:59:12 | 2018-03-21T11:59:12 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 719 | py | # -*- coding: utf-8 -*-
from __future__ import absolute_import, division, print_function
from experiments.models import Experiment
def is_experiment_still_running(experiment_id=None, experiment_uuid=None):
if not any([experiment_id, experiment_uuid]) or all([experiment_id, experiment_uuid]):
raise ValueE... | [
"mouradmourafiq@gmail.com"
] | mouradmourafiq@gmail.com |
f4ee36d85f337be493ffa614eb246403c3fd37ca | 2bd4392a0929bf294df65bf45338d62e22474a25 | /expenses/utils.py | 07e29fb03ca4ec007e93ca6c77e29ab631a28c23 | [
"BSD-2-Clause",
"BSD-3-Clause"
] | permissive | DjangoGworls/django-expenses | c5c7825017884be1bd53d5d19ee15acfb7bafbbd | 60f2c20c21a9f01d7efa169b501e3beb361795d1 | refs/heads/master | 2023-01-30T01:20:45.723489 | 2020-11-07T11:13:03 | 2020-11-07T11:13:23 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,995 | py | # Django-Expenses
# Copyright © 2018-2020, Chris Warrick.
# All rights reserved.
# See /LICENSE for licensing information.
"""Assorted Expenses utilities."""
import babel.numbers
import datetime
import decimal
import iso8601
import itertools
import typing
from django.utils import timezone
from django.conf import sett... | [
"kwpolska@gmail.com"
] | kwpolska@gmail.com |
9fbba12d321ad7bcae325cc7b8e8bc3d77faa827 | b557781831f6345f36f5d35b9c5fa6cbdb4c4815 | /billing/yup/views.py | eb97a8947f82f58dad204478f718bf8e1651efe5 | [] | no_license | komsihon/Project1 | 5c067bcc2f299a28163eccf27716ed092e070b78 | e32c481ad358c2a8af52d95a9bbc2f9faebfd703 | refs/heads/master | 2021-06-03T23:52:21.555310 | 2021-01-13T10:53:24 | 2021-01-13T10:53:24 | 98,784,648 | 0 | 1 | null | null | null | null | UTF-8 | Python | false | false | 7,108 | py | import json
import traceback
import requests
from django.conf import settings
from django.db import transaction
from django.http import HttpResponse
from django.http.response import HttpResponseRedirect
from django.shortcuts import render
from django.template.defaultfilters import slugify
from django.utils.module_load... | [
"rsihon@gmail.com"
] | rsihon@gmail.com |
9e17efeaae7712f632dfc951b8c4faccf09300ea | 3a85089c2498ff04d1b9bce17a4b8bf6cf2380c9 | /EventFilter/Cosmics/python/__init__.py | 8de5e10f583a8354f7bdce130bf75b64b564ba0f | [] | no_license | sextonkennedy/cmssw-ib | c2e85b5ffa1269505597025e55db4ffee896a6c3 | e04f4c26752e0775bd3cffd3a936b288ee7b0268 | HEAD | 2016-09-01T20:09:33.163593 | 2013-04-26T12:05:17 | 2013-04-29T16:40:30 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 190 | py | #Automatically created by SCRAM
import os
__path__.append(os.path.dirname(os.path.abspath(__file__).rsplit('/EventFilter/Cosmics/',1)[0])+'/cfipython/slc6_amd64_gcc480/EventFilter/Cosmics')
| [
"giulio.eulisse@cern.ch"
] | giulio.eulisse@cern.ch |
5eee522f1c71624e222b152f905e6ca8a07c2df5 | b06bceb8fdc24e0c890fb2201c535cb660a94f86 | /pretrain_module/mbart_deprecated.py | ac4b7e85270d93661fd4ae3d1554b48ad9738826 | [
"MIT"
] | permissive | quanpn90/NMTGMinor | 7f294b40763b3f586d34ef4985799b851052f2ed | 5e1e424d0d9c2135a456e372a2ea9ee49de5bd2c | refs/heads/master | 2023-08-22T14:53:31.420276 | 2023-08-21T08:26:49 | 2023-08-21T08:26:49 | 116,663,163 | 92 | 39 | NOASSERTION | 2023-07-31T15:07:35 | 2018-01-08T10:33:56 | HTML | UTF-8 | Python | false | false | 8,832 | py | from .modeling_bart import MBartAttention
class MBartCrossAttentionSlow(MBartAttention):
def convert_fast_attention(self):
pass
def forward(
self,
hidden_states: torch.Tensor,
key_value_states: Optional[torch.Tensor] = None,
attention_mask: Optional[t... | [
"quanpn90@gmail.com"
] | quanpn90@gmail.com |
6cc0b40552a7b84b67654c5343748b10becaba83 | 8997a0bf1e3b6efe5dd9d5f307e1459f15501f5a | /qbittorrent_examples/common.py | ddc95e8e8fe8667135cad88bfda306fb07fca849 | [
"CC-BY-4.0"
] | permissive | stepik/SimplePyScripts | 01092eb1b2c1c33756427abb2debbd0c0abf533f | 3259d88cb58b650549080d6f63b15910ae7e4779 | refs/heads/master | 2023-05-15T17:35:55.743164 | 2021-06-11T22:59:07 | 2021-06-11T22:59:07 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 1,358 | py | #!/usr/bin/env python3
# -*- coding: utf-8 -*-
__author__ = 'ipetrash'
import sys
from typing import List, Dict
from pathlib import Path
# pip install tabulate
from tabulate import tabulate
# pip install python-qbittorrent
from qbittorrent import Client
from config import IP_HOST, USER, PASSWORD
sys.path.append(... | [
"ilya.petrash@inbox.ru"
] | ilya.petrash@inbox.ru |
c589a73bdb953c385df8a3734ad9b98afacc6e90 | 72839718a4b47b1babd4ad895ecd503a0a0e14d2 | /stembot/executor/ticket.py | fff953e6803693a1039328f71b3155b6a80807ac | [
"MIT"
] | permissive | phnomcobra/stembot-python | 6fb0d9a2874fc1bb8b8e5cf69e9f4d39c38dba5a | 497dd782556d62eeb9e9301f9de37332d93207d7 | refs/heads/master | 2021-06-17T10:56:33.148454 | 2021-02-23T00:58:00 | 2021-02-23T00:58:00 | 174,921,135 | 0 | 0 | MIT | 2021-02-07T03:48:14 | 2019-03-11T03:44:21 | Python | UTF-8 | Python | false | false | 13,314 | py | #!/usr/bin/python3
ASYNC_TICKET_TIMEOUT = 3600
SYNC_TICKET_TIMEOUT = 15
import traceback
from base64 import b64encode, b64decode
from time import time, sleep
from threading import Thread, Timer
from stembot.dao.ramdocument import Collection as RAMCollection
from stembot.dao.document import Collection as SQLCollecti... | [
"phnomcobra@gmail.com"
] | phnomcobra@gmail.com |
69192c6ab4ee2b552ad6a32cd7ad4ec54844ebd7 | a4e187eb26c926a72ee260d3eb4f07a57eb31af0 | /src/aceinna/devices/openrtk/lan_provider.py | 8ea2bf70d39ddc9359b6154897157531eb45a6e2 | [
"Apache-2.0"
] | permissive | BrunoScaglione/python-openimu | 2cab6386a65dba3676b152ba4ed07e3579e47aa4 | 5653fad05b735a26c44e46c4ee023137e621e58e | refs/heads/master | 2023-06-04T08:36:30.982960 | 2021-05-07T09:09:12 | 2021-05-07T09:09:12 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 27,756 | py | import os
import time
import json
import datetime
import threading
import math
import re
from ..widgets import (
NTRIPClient, LanDataLogger, LanDebugDataLogger, LanRTCMDataLogger
)
from ...framework.utils import (
helper, resource
)
from ...framework.context import APP_CONTEXT
from ..base.provider_base import O... | [
"ywsong@aceinna.com"
] | ywsong@aceinna.com |
4d066a1f3af37064dc6990b14a9a2e2baf54dc92 | 8f70b40ef1c657ee14accfe6e2f8b1ebb1bebb7e | /employeeform/migrations/0004_auto_20191206_1630.py | f84f3d3d85c39b082cf3985e9977f625ffe70444 | [] | no_license | TejashviVerma/School_ERP | e3d6f1aabe92167c2b55c0b1682dde505bb04edd | 11406da8b1d8701b7ea55f75c76f1cbf44a72c53 | refs/heads/master | 2023-08-03T15:10:11.481306 | 2020-09-13T18:02:40 | 2020-09-13T18:02:40 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 381 | py | # Generated by Django 2.2.5 on 2019-12-06 11:00
from django.db import migrations
class Migration(migrations.Migration):
dependencies = [
('employeeform', '0003_auto_20191206_1619'),
]
operations = [
migrations.RenameField(
model_name='employeedocuments',
old_name... | [
"yashboura303@gmail.com"
] | yashboura303@gmail.com |
482a9c23b8b78c4c068f2a92b69400934aa9d8fd | 5f06ea565f6d0d555a0034de591c1948b925a7e7 | /blog/views.py | 1cae3ad2d74213e99b7c23fb9a3da2f424d190bb | [] | no_license | cement-hools/blog_by_molchanov | 82ef3385080320b74a1cd9c4c21446d8f0ae60e4 | da0a4c2c083c5c1da0d720a631ae1253792b32be | refs/heads/main | 2023-03-30T08:51:41.100697 | 2021-03-28T02:09:49 | 2021-03-28T02:09:49 | 350,162,121 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 2,702 | py | from django.contrib.auth.mixins import LoginRequiredMixin
from django.core.paginator import Paginator
from django.db.models import Q
from django.shortcuts import render
from django.views.generic import View
from blog.forms import TagForm, PostForm
from blog.models import Post, Tag
from blog.utils import (ObjectDetailM... | [
"cement-fan@ya.ru"
] | cement-fan@ya.ru |
65da08b0f3c75f793eca363ec016e0441370c495 | a47ac7c64cb6bb1f181eadff8e4b24735c19080a | /PythonStudy/9-Tkinter/4-Entry.py | fc6d9a973f75667cf9bcbae7cca69b495df559b5 | [
"MIT"
] | permissive | CoderTitan/PythonDemo | 6dcc88496b181df959a9d43b963fe43a6e4cb032 | feb5ef8be91451b4622764027ac684972c64f2e0 | refs/heads/master | 2020-03-09T09:15:28.299827 | 2018-08-21T03:43:25 | 2018-08-21T03:43:25 | 128,708,650 | 1 | 1 | null | null | null | null | UTF-8 | Python | false | false | 1,321 | py | # 主窗口
import tkinter
# 验证输入的文字
def varileText():
text = entry4.get()
if text != '1':
print('对喽')
return True
print('错漏')
return False
#
def testInvaild():
print('invaildCommanf被调用')
return True
# 创建主窗口
window = tkinter.Tk()
# 设置标题
window.title('Titanjun')
# 设置窗口大小
window.ge... | [
"quanjunt@163.com"
] | quanjunt@163.com |
c7224b78c1a6f736145512b1515152716e084fb0 | 7a63ce94e1806a959c9c445c2e0bae95afb760c8 | /tests/user/test_update_credentials.py | 0525fc1882db4236ea941f77e653a698474a366a | [
"MIT"
] | permissive | pklauke/pycamunda | 20b54ceb4a40e836148e84912afd04d78d6ba0ec | 3faac4037212df139d415ee1a54a6594ae5e9ac5 | refs/heads/master | 2023-08-18T10:23:30.503737 | 2022-04-17T18:34:40 | 2022-04-17T18:34:40 | 240,333,835 | 40 | 16 | MIT | 2023-09-12T13:29:08 | 2020-02-13T18:37:25 | Python | UTF-8 | Python | false | false | 2,128 | py | # -*- coding: utf-8 -*-
import unittest.mock
import pytest
import pycamunda.base
import pycamunda.user
import pycamunda.resource
from tests.mock import raise_requests_exception_mock, not_ok_response_mock
def test_update_credentials_params(engine_url, update_credentials_input):
update_credentials = pycamunda.us... | [
"peter.klauke@tu-dortmund.de"
] | peter.klauke@tu-dortmund.de |
9edb6fb910255cf29713ca49bd8f2e57d1186ea7 | a5aa3e80fe2e97cc9de3d42be873fdf468a68968 | /a10_openstack_lib/resources/a10_scaling_group.py | 312cd817ddd0ea9bc95f2784cacf72012e30ba03 | [
"Apache-2.0"
] | permissive | Cedev/a10-openstack-lib | 60911420f781db99f9d7456be5c4c707985c3c2d | 23c6a5ae2cfaeb5bb950e96be3a79c3b0e014247 | refs/heads/master | 2020-04-05T22:53:54.765410 | 2016-06-07T23:02:01 | 2016-06-07T23:02:01 | 61,076,970 | 0 | 0 | null | 2016-06-13T23:41:50 | 2016-06-13T23:41:49 | Python | UTF-8 | Python | false | false | 12,633 | py | # Copyright (C) 2016 A10 Networks Inc. All rights reserved.
EXTENSION = 'a10-scaling-group'
SERVICE = "A10_SCALING_GROUP"
SCALING_GROUPS = 'a10_scaling_groups'
SCALING_GROUP = 'a10_scaling_group'
SCALING_GROUP_WORKERS = 'a10_scaling_group_workers'
SCALING_GROUP_WORKER = 'a10_scaling_group_worker'
SCALING_POLICIES ... | [
"doug@parksidesoftware.com"
] | doug@parksidesoftware.com |
b2741fa2aa47d2ca507a4a587d78662b490be852 | b47f2e3f3298388b1bcab3213bef42682985135e | /experiments/jacobi-2d/tmp_files/4634.py | 598e8470565aa941811dde2f95b33c4baece406f | [
"BSD-2-Clause"
] | permissive | LoopTilingBenchmark/benchmark | 29cc9f845d323431e3d40e878cbfc6d1aad1f260 | 52a3d2e70216552a498fd91de02a2fa9cb62122c | refs/heads/master | 2020-09-25T09:45:31.299046 | 2019-12-04T23:25:06 | 2019-12-04T23:25:06 | 225,975,074 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 366 | py | from chill import *
source('/uufs/chpc.utah.edu/common/home/u1142914/lib/ytopt_vinu/polybench/polybench-code/stencils/jacobi-2d/kernel.c')
destination('/uufs/chpc.utah.edu/common/home/u1142914/lib/ytopt_vinu/experiments/jacobi-2d/tmp_files/4634.c')
procedure('kernel_jacobi_2d')
loop(0)
known(' n > 2 ')
tile(0,2,16,2)... | [
"nashenruoyang@163.com"
] | nashenruoyang@163.com |
b85e6af344facb6e0df6e9ed8dff20da26f7144a | 10ddfb2d43a8ec5d47ce35dc0b8acf4fd58dea94 | /Python/merge-strings-alternately.py | 107572aa3949742adfc4813ca836790e9dbcd7cc | [
"MIT"
] | permissive | kamyu104/LeetCode-Solutions | f54822059405ef4df737d2e9898b024f051fd525 | 4dc4e6642dc92f1983c13564cc0fd99917cab358 | refs/heads/master | 2023-09-02T13:48:26.830566 | 2023-08-28T10:11:12 | 2023-08-28T10:11:12 | 152,631,182 | 4,549 | 1,651 | MIT | 2023-05-31T06:10:33 | 2018-10-11T17:38:35 | C++ | UTF-8 | Python | false | false | 471 | py | # Time: O(m + n)
# Space: O(1)
class Solution(object):
def mergeAlternately(self, word1, word2):
"""
:type word1: str
:type word2: str
:rtype: str
"""
result = []
i = 0
while i < len(word1) or i < len(word2):
if i < len(word1):
... | [
"noreply@github.com"
] | kamyu104.noreply@github.com |
d3d2478915380b6f8d4f5778c5babd647003d786 | f9d564f1aa83eca45872dab7fbaa26dd48210d08 | /huaweicloud-sdk-dataartsstudio/huaweicloudsdkdataartsstudio/v1/model/show_instance_result_response.py | 89a066b6d19712691fb0599b6d0fc736ad86c3d5 | [
"Apache-2.0"
] | permissive | huaweicloud/huaweicloud-sdk-python-v3 | cde6d849ce5b1de05ac5ebfd6153f27803837d84 | f69344c1dadb79067746ddf9bfde4bddc18d5ecf | refs/heads/master | 2023-09-01T19:29:43.013318 | 2023-08-31T08:28:59 | 2023-08-31T08:28:59 | 262,207,814 | 103 | 44 | NOASSERTION | 2023-06-22T14:50:48 | 2020-05-08T02:28:43 | Python | UTF-8 | Python | false | false | 4,168 | py | # coding: utf-8
import six
from huaweicloudsdkcore.sdk_response import SdkResponse
from huaweicloudsdkcore.utils.http_utils import sanitize_for_serialization
class ShowInstanceResultResponse(SdkResponse):
"""
Attributes:
openapi_types (dict): The key is attribute name
and ... | [
"hwcloudsdk@huawei.com"
] | hwcloudsdk@huawei.com |
990724591460f6a3454e06b1a3df500f07f90241 | 58ee1dc37b57e0b4f06cf383c6a9e0654f490150 | /python-tflearn-git/lilac.py | 5214cab05f245eed7f14892fa3df205c85351b16 | [] | no_license | MikeyBaldinger/arch4edu | f3af87ef3a8d4cd78fde7e0ef75658c17dbe8c06 | c1775bf7fe0ffc87f3c8b4109fb1e8acde12a430 | refs/heads/master | 2022-12-23T16:40:55.513537 | 2020-09-28T21:00:59 | 2020-09-28T21:00:59 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 346 | py | #!/usr/bin/env python3
from lilaclib import *
maintainers = [{'github': 'petronny', 'email': 'Jingbei Li <i@jingbei.li>'}]
update_on = [{'aur': None}, {'github': 'tflearn/tflearn'}, {'alias': 'python'}]
build_prefix = 'extra-x86_64'
pre_build = aur_pre_build
post_build = aur_post_build
if __name__ == '__main__':
... | [
"i@jingbei.li"
] | i@jingbei.li |
54073a0a96169761ca6e309c1f572aa135b71df0 | 682319f56c17e949bab0d6e418838d33977dd760 | /RP/search_element.py | 6bddc659f268253cf4d1a9296c7704a8a0a4f81b | [] | no_license | DilipBDabahde/PythonExample | 8eb70773a783b1f4b6cf6d7fbd2dc1302af8aa1b | 669762a8d9ee81ce79416d74a4b6af1e2fb63865 | refs/heads/master | 2020-08-23T01:05:44.788080 | 2020-07-25T21:59:52 | 2020-07-25T21:59:52 | 216,511,985 | 1 | 1 | null | null | null | null | UTF-8 | Python | false | false | 1,431 | py | '''
.Write a program which accept N numbers from user and store it into List. Accept one another number from user and
return frequency of that number from List.
input: Num of elements: 12
input Elements: 5 8 6 8 5 9 3 7 2 21 1 5
Element to search = 5
output: Freq of search element is: 3
'''
def search_El... | [
"noreply@github.com"
] | DilipBDabahde.noreply@github.com |
34e6d9bd427d80013aeb40dfba6f4734f2d186e4 | e6bc1f55371786dad70313eb468a3ccf6000edaf | /Datasets/py-if-else/Correct/076.py | 2c07f238adcfd70b429c52cda3509dc1a5eb15ba | [] | no_license | prateksha/Source-Code-Similarity-Measurement | 9da92e3b22c372ed6ea54d8b6ab2c5921e8c41c0 | fb371b837917794d260a219a1ca09c46a5b15962 | refs/heads/master | 2023-01-04T07:49:25.138827 | 2020-10-25T14:43:57 | 2020-10-25T14:43:57 | 285,744,963 | 3 | 0 | null | null | null | null | UTF-8 | Python | false | false | 178 | py | #!/bin/python3
import sys
N = int(input().strip())
if(N%2==0) :
if (N<5 or N>20):
print('Not Weird')
else :
print ("Weird")
else :
print ("Weird") | [
"pratekshau@gmail.com"
] | pratekshau@gmail.com |
850985fddff858e55bfd488b48ba7aff47e39da6 | fbf73800e27f66960f677a284c2771e66708973b | /subreview_lib/classicreviewdecisionpage.py | dfbc360e28ba50b5a16d59e1c83ece7bce6d2c65 | [
"MIT"
] | permissive | allankellynet/mimas | 94140a341693d4729b3cdf5ea94ef2f7e550aad6 | 10025d43bba9e84f502a266760786842e7158a05 | refs/heads/master | 2022-05-30T21:35:06.083902 | 2020-02-27T14:04:27 | 2020-02-27T14:04:27 | 235,146,506 | 0 | 0 | MIT | 2022-05-25T04:56:13 | 2020-01-20T16:30:39 | Python | UTF-8 | Python | false | false | 3,568 | py | #-----------------------------------------------------
# Mimas: conference submission and review system
# (c) Allan Kelly 2016-2020 http://www.allankelly.net
# Licensed under MIT License, see LICENSE file
# -----------------------------------------------------
# System imports
# Google imports
import logging
from go... | [
"allan@allankelly.net"
] | allan@allankelly.net |
9ba77a93b34b31c7c184176444d94a568deb7688 | e4d4149a717d08979953983fa78fea46df63d13d | /Week5/Day1/XP.py | 2c661c7abdf2c8897ce0f26c7fbce353061e2d6f | [] | no_license | fayblash/DI_Bootcamp | 72fd75497a2484d19c779775c49e4306e602d10f | a4e8f62e338df5d5671fd088afa575ea2e290837 | refs/heads/main | 2023-05-05T20:55:31.513558 | 2021-05-27T06:48:40 | 2021-05-27T06:48:40 | 354,818,813 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 5,863 | py | # # Exercise 1: Cats
# # Instructions
# # Using this class
# class Cat:
# def __init__(self, name, age):
# self.name = name
# self.age = age
# def oldest_cat(cat_list):
# oldest_current=cat_list[0]
# for cat in cat_list:
# if cat.age>oldest_current.age:
# oldest_current... | [
"fayblash@gmail.com"
] | fayblash@gmail.com |
d3a3564a7a3dfa3476aed8c37bc0eefe96e862bd | b54f9fb585648e4fe0b8ca727f42c97a6c1486fd | /variability/varModels.py | 5006e96121da25ab9e80c656b99ff8bf870894bf | [] | no_license | tribeiro/SMAPS | 46a36ab3fd74e35d97d9b43d5d80d88d9581b9da | b1e8dd9444e7fcbc7a82ab30941bab224b5ae600 | refs/heads/master | 2021-01-22T22:35:09.228649 | 2014-05-08T11:19:47 | 2014-05-08T11:19:47 | 19,570,868 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 3,107 | py |
import numpy as np
###################################################################################################
def ecbinary(time,period,ecduration,depth):
'''
Simulate eclipsing binary.
'''
phase = time / period
cycle = np.ceil(phase)
phase = phase - cycle
mask = np.bitwise_and(phase > -ecduratio... | [
"tiago.astro@gmail.com"
] | tiago.astro@gmail.com |
5694f828530a430b4aca5569f67e50d0baf88575 | aff694b019806db8f8cd66fd205f9049351bb10c | /bin/wheel | e54d9f83eb92ea97085a22f82f854bd08e745464 | [] | no_license | mikilabarda/my-first-blog | 3885d08f87e9c3f05da7000b9e60d29f3895efd3 | 7e1476fa75e6db95bfe8685ad43a233777166071 | refs/heads/master | 2021-05-30T19:25:38.022284 | 2016-03-20T05:31:16 | 2016-03-20T05:31:16 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 233 | #!/Users/Miki/Desktop/env/bin/python2.7
# -*- coding: utf-8 -*-
import re
import sys
from wheel.tool import main
if __name__ == '__main__':
sys.argv[0] = re.sub(r'(-script\.pyw|\.exe)?$', '', sys.argv[0])
sys.exit(main())
| [
"you@example.com"
] | you@example.com | |
e3399daf37f287b2f7c0b62e55f30e6611bf5d97 | 0f89043a9e7caac53bc76cd359d704d5cfaef3db | /main/migrations/0044_remove_tag_resources.py | eaef56cf0970beb2e07945c8e6a10d9b814acaf4 | [] | no_license | sirodoht/knowhub | f704d987f6c800717c2dba7b811d05b0d85801fd | 4c242a9f1bc14a11fbf799119b19d79c4201ba2d | refs/heads/master | 2022-03-05T15:28:55.539951 | 2019-11-18T18:33:42 | 2019-11-18T18:33:42 | 134,064,221 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 258 | py | # Generated by Django 2.1 on 2018-08-27 13:24
from django.db import migrations
class Migration(migrations.Migration):
dependencies = [("main", "0043_auto_20180826_0050")]
operations = [migrations.RemoveField(model_name="tag", name="resources")]
| [
"theodorekeloglou@gmail.com"
] | theodorekeloglou@gmail.com |
29b9663bb72f21946ffdb20c501c498e7c0cfee6 | f2e09eea7c995df2cac15f16ae5eeb79b6fc748c | /odmltools/info.py | cda1f635ddc615fb0e6c0b291916d4bb2d05c164 | [
"BSD-2-Clause"
] | permissive | mpsonntag/odmltools | 676d829212ababd3ea3eb3396f25d0df8f3a4373 | 87e67fc737fbad2bd9866d529d47abbc2b7115d1 | refs/heads/master | 2021-07-13T07:54:23.214505 | 2021-06-21T18:11:19 | 2021-06-21T18:11:19 | 221,953,387 | 0 | 0 | null | 2019-11-15T15:40:14 | 2019-11-15T15:40:14 | null | UTF-8 | Python | false | false | 357 | py | import os
import json
INSTALL_PATH = os.path.dirname(__file__)
with open(os.path.join(INSTALL_PATH, "info.json")) as infofile:
infodict = json.load(infofile)
VERSION = infodict["VERSION"]
AUTHOR = infodict["AUTHOR"]
COPYRIGHT = infodict["COPYRIGHT"]
CONTACT = infodict["CONTACT"]
HOMEPAGE = infodict["HOMEPAGE"]
C... | [
"michael.p.sonntag@gmail.com"
] | michael.p.sonntag@gmail.com |
7acf5941940c678da4795277f2ddd08749ad98a3 | ca7aa979e7059467e158830b76673f5b77a0f5a3 | /Python_codes/p03192/s975847643.py | 0b87008f474274d7ec53b07ee4ec58d374c6d871 | [] | no_license | Aasthaengg/IBMdataset | 7abb6cbcc4fb03ef5ca68ac64ba460c4a64f8901 | f33f1c5c3b16d0ea8d1f5a7d479ad288bb3f48d8 | refs/heads/main | 2023-04-22T10:22:44.763102 | 2021-05-13T17:27:22 | 2021-05-13T17:27:22 | 367,112,348 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 163 | py | n = int(input())
li = []
while n > 0:
li.append(n%10)
n //= 10
li.reverse()
ans = 0
for i in range(len(li)):
if li[i] == 2:
ans += 1
print(ans) | [
"66529651+Aastha2104@users.noreply.github.com"
] | 66529651+Aastha2104@users.noreply.github.com |
a9fe63f7d3ec967b0984566e83707772eedadfb5 | f07a42f652f46106dee4749277d41c302e2b7406 | /Data Set/bug-fixing-5/765188917950a2d371982a81fa142747ea65f14a-<binned_statistic_2d>-bug.py | 37399820742f3945f3f54302e29aeac36416da57 | [] | no_license | wsgan001/PyFPattern | e0fe06341cc5d51b3ad0fe29b84098d140ed54d1 | cc347e32745f99c0cd95e79a18ddacc4574d7faa | refs/heads/main | 2023-08-25T23:48:26.112133 | 2021-10-23T14:11:22 | 2021-10-23T14:11:22 | null | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 6,928 | py | def binned_statistic_2d(x, y, values, statistic='mean', bins=10, range=None, expand_binnumbers=False):
"\n Compute a bidimensional binned statistic for one or more sets of data.\n\n This is a generalization of a histogram2d function. A histogram divides\n the space into bins, and returns the count of the ... | [
"dg1732004@smail.nju.edu.cn"
] | dg1732004@smail.nju.edu.cn |
8845672ea92d7bddefee80d4f9a40864a8f36823 | bb198232df12a1adb9e8a6164ff2a403bf3107cf | /cookie-monster/MonsterBrowser.py | da21df7b654d09e613e51a1984046a21401e3364 | [] | no_license | vanello/wifi-arsenal | 9eb79a43dfdd73d3ead1ccd5d2caf9bad9e327ee | 1ca4c5a472687f8f017222893f09a970652e9a51 | refs/heads/master | 2021-01-16T22:00:37.657041 | 2015-09-03T03:40:43 | 2015-09-03T03:40:43 | 42,060,303 | 1 | 0 | null | 2015-09-07T15:24:11 | 2015-09-07T15:24:11 | null | UTF-8 | Python | false | false | 3,179 | py | from PyQt4.QtCore import *
from PyQt4.QtGui import *
from PyQt4.QtWebKit import *
from PyQt4.QtNetwork import *
import getopt
import sys
import re
class MyBrowser(QWebView):
def __init__(self,father=None):
super(MyBrowser, self).__init__(father)
self.page().setLinkDelegationPolicy(QWebPage.Delegat... | [
"oleg.kupreev@gmail.com"
] | oleg.kupreev@gmail.com |
b50ab0437bdeb0851adabcf7abdab17632f1e3ef | 82b495a208ebdeb71314961021fbfe767de57820 | /chapter-06/temperature.py | 6c3619f4fe12c91df242c2a86240bd498aa1abd1 | [
"MIT"
] | permissive | krastin/pp-cs3.0 | 7c860794332e598aa74278972d5daa16853094f6 | 502be9aac2d84215db176864e443c219e5e26591 | refs/heads/master | 2020-05-28T02:23:58.131428 | 2019-11-13T13:06:08 | 2019-11-13T13:06:08 | 188,853,205 | 0 | 0 | MIT | 2019-11-13T13:06:09 | 2019-05-27T13:56:41 | Python | UTF-8 | Python | false | false | 469 | py | def convert_to_celsius(fahrenheit: float) -> float:
"""Return the number of Celsius degrees equivalent to fahrenheit
degrees.
>>> convert_to_celsius(75)
23.88888888888889
"""
return (fahrenheit - 32.0) * 5.0 / 9.0
def above_freezing(celsius: float) -> bool:
"""Return true if the temper... | [
"krastin@hashicorp.com"
] | krastin@hashicorp.com |
38af0a8f4ec7b286afc5854b6b8d7664edf331e0 | f4df9e53f984f293786fa3b890ab15f8c20abefd | /Django/beltreview/beltreview/urls.py | 7767d39b40ce4346388762908fc3bc5c218872b4 | [] | no_license | Chiefautoparts/Python_Party | bd0fbac9ea003f92be0f97d6f1d8f8d51c98a1b8 | 3d81052c51f14d5fc5dbd25317d23b891e766d8e | refs/heads/master | 2021-01-25T07:55:05.218262 | 2017-06-30T04:44:18 | 2017-06-30T04:44:18 | 93,680,027 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 767 | py | """beltreview URL Configuration
The `urlpatterns` list routes URLs to views. For more information please see:
https://docs.djangoproject.com/en/1.11/topics/http/urls/
Examples:
Function views
1. Add an import: from my_app import views
2. Add a URL to urlpatterns: url(r'^$', views.home, name='home')
Class... | [
"chiefautoparts@outlook.com"
] | chiefautoparts@outlook.com |
d6ee5dc1abe1d518d68ca2e2446b88515339d72a | 92cec18f145b71403d4c5511084a0da5fdeca9fb | /tests/test_bem_filesystem.py | 14ce83ae0635b4f6c0f08f8a41a49b1b55f6bac2 | [] | no_license | Zed-chi/bem_fs | 12b320861c5984df0a222a6f4548f30a3de2a78d | a013e4d31eddd343d35a5edb3f99ef36535c73d4 | refs/heads/master | 2022-11-06T17:16:05.292183 | 2020-06-30T05:22:42 | 2020-06-30T05:22:42 | 275,676,651 | 0 | 0 | null | null | null | null | UTF-8 | Python | false | false | 95 | py | from bem_filesystem import __version__
def test_version():
assert __version__ == "0.1.0"
| [
"zed-chi@mail.ru"
] | zed-chi@mail.ru |
65db9b7872898345eee84550ab79aa3f9bbe16ab | 6ed034d0a5e239d7b0c528b287451409ffb4a494 | /mmpose/datasets/samplers/__init__.py | da09effaf20fefe1a102277672b98db7d884f002 | [
"Apache-2.0"
] | permissive | ViTAE-Transformer/ViTPose | 8f9462bd5bc2fb3e66de31ca1d03e5a9135cb2bf | d5216452796c90c6bc29f5c5ec0bdba94366768a | refs/heads/main | 2023-05-23T16:32:22.359076 | 2023-03-01T06:42:22 | 2023-03-01T06:42:22 | 485,999,907 | 869 | 132 | Apache-2.0 | 2023-03-01T06:42:24 | 2022-04-27T01:09:19 | Python | UTF-8 | Python | false | false | 134 | py | # Copyright (c) OpenMMLab. All rights reserved.
from .distributed_sampler import DistributedSampler
__all__ = ['DistributedSampler']
| [
"annblessus@gmail.com"
] | annblessus@gmail.com |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.